N-(2-((6-(2-((2,6-Dichloro-3,5-dimethoxyphenyl)amino)pyridin-3-yl)pyrimidin-4-yl)amino)-3-methylphenyl)propionamide

ID: ALA4757733

PubChem CID: 146450690

Max Phase: Preclinical

Molecular Formula: C27H26Cl2N6O3

Molecular Weight: 553.45

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCC(=O)Nc1cccc(C)c1Nc1cc(-c2cccnc2Nc2c(Cl)c(OC)cc(OC)c2Cl)ncn1

Standard InChI:  InChI=1S/C27H26Cl2N6O3/c1-5-22(36)33-17-10-6-8-15(2)25(17)34-21-12-18(31-14-32-21)16-9-7-11-30-27(16)35-26-23(28)19(37-3)13-20(38-4)24(26)29/h6-14H,5H2,1-4H3,(H,30,35)(H,33,36)(H,31,32,34)

Standard InChI Key:  IUPVCWCINCFOKH-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 38 41  0  0  0  0  0  0  0  0999 V2000
   15.3868   -4.4168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3857   -5.2443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1005   -5.6571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8171   -5.2438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8142   -4.4132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0987   -4.0041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5271   -3.9981    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   16.1003   -6.4822    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   14.6709   -5.6562    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.0963   -3.1791    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.8096   -2.7644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9567   -5.2431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5322   -5.6552    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.2461   -5.2416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9578   -5.6534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6712   -5.2405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6704   -4.4145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9503   -4.0033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2398   -4.4187    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.9607   -6.4768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2445   -6.8889    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.2442   -7.7131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9593   -8.1263    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.6762   -7.7094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6729   -6.8864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3922   -8.1193    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.1052   -7.7041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8175   -8.1151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5301   -7.7007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5275   -6.8747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8065   -6.4650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0969   -6.8818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3789   -6.4755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8191   -8.9401    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.5343   -9.3514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5358  -10.1765    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.2481   -8.9376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9633   -9.3489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  3  8  1  0
  2  9  1  0
  6 10  1  0
 10 11  1  0
  9 12  1  0
  4 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 15 20  1  0
 24 26  1  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
 32 33  1  0
 28 34  1  0
 34 35  1  0
 35 36  2  0
 35 37  1  0
 37 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4757733

    ---

Associated Targets(Human)

FGFR4 Tclin Fibroblast growth factor receptor 4 (3668 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 553.45Molecular Weight (Monoisotopic): 552.1443AlogP: 7.01#Rotatable Bonds: 9
Polar Surface Area: 110.29Molecular Species: NEUTRALHBA: 8HBD: 3
#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 12.02CX Basic pKa: 4.19CX LogP: 6.28CX LogD: 6.28
Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.20Np Likeness Score: -0.93

References

1. Rezende Miranda R,Fu Y,Chen X,Perino J,Cao P,Carpten J,Chen Y,Zhang C.  (2020)  Development of a Potent and Specific FGFR4 Inhibitor for the Treatment of Hepatocellular Carcinoma.,  63  (20): [PMID:33030342] [10.1021/acs.jmedchem.0c00044]

Source