The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(2-((6-(2-((2,6-Dichloro-3,5-dimethoxyphenyl)amino)pyridin-3-yl)pyrimidin-4-yl)amino)-3-methylphenyl)propionamide ID: ALA4757733
PubChem CID: 146450690
Max Phase: Preclinical
Molecular Formula: C27H26Cl2N6O3
Molecular Weight: 553.45
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCC(=O)Nc1cccc(C)c1Nc1cc(-c2cccnc2Nc2c(Cl)c(OC)cc(OC)c2Cl)ncn1
Standard InChI: InChI=1S/C27H26Cl2N6O3/c1-5-22(36)33-17-10-6-8-15(2)25(17)34-21-12-18(31-14-32-21)16-9-7-11-30-27(16)35-26-23(28)19(37-3)13-20(38-4)24(26)29/h6-14H,5H2,1-4H3,(H,30,35)(H,33,36)(H,31,32,34)
Standard InChI Key: IUPVCWCINCFOKH-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 41 0 0 0 0 0 0 0 0999 V2000
15.3868 -4.4168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3857 -5.2443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1005 -5.6571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8171 -5.2438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8142 -4.4132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0987 -4.0041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5271 -3.9981 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
16.1003 -6.4822 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
14.6709 -5.6562 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.0963 -3.1791 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.8096 -2.7644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9567 -5.2431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5322 -5.6552 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.2461 -5.2416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9578 -5.6534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6712 -5.2405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6704 -4.4145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9503 -4.0033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2398 -4.4187 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.9607 -6.4768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2445 -6.8889 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.2442 -7.7131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9593 -8.1263 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.6762 -7.7094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6729 -6.8864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3922 -8.1193 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.1052 -7.7041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8175 -8.1151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5301 -7.7007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5275 -6.8747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8065 -6.4650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0969 -6.8818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3789 -6.4755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8191 -8.9401 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.5343 -9.3514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5358 -10.1765 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.2481 -8.9376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9633 -9.3489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
3 8 1 0
2 9 1 0
6 10 1 0
10 11 1 0
9 12 1 0
4 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
15 20 1 0
24 26 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
32 33 1 0
28 34 1 0
34 35 1 0
35 36 2 0
35 37 1 0
37 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 553.45Molecular Weight (Monoisotopic): 552.1443AlogP: 7.01#Rotatable Bonds: 9Polar Surface Area: 110.29Molecular Species: NEUTRALHBA: 8HBD: 3#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.02CX Basic pKa: 4.19CX LogP: 6.28CX LogD: 6.28Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.20Np Likeness Score: -0.93
References 1. Rezende Miranda R,Fu Y,Chen X,Perino J,Cao P,Carpten J,Chen Y,Zhang C. (2020) Development of a Potent and Specific FGFR4 Inhibitor for the Treatment of Hepatocellular Carcinoma., 63 (20): [PMID:33030342 ] [10.1021/acs.jmedchem.0c00044 ]