N-butyl-2-[[2-(4-hydroxyanilino)-2-oxo-ethyl]sulfamoyl]benzamide

ID: ALA4757750

PubChem CID: 146660799

Max Phase: Preclinical

Molecular Formula: C19H23N3O5S

Molecular Weight: 405.48

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCCNC(=O)c1ccccc1S(=O)(=O)NCC(=O)Nc1ccc(O)cc1

Standard InChI:  InChI=1S/C19H23N3O5S/c1-2-3-12-20-19(25)16-6-4-5-7-17(16)28(26,27)21-13-18(24)22-14-8-10-15(23)11-9-14/h4-11,21,23H,2-3,12-13H2,1H3,(H,20,25)(H,22,24)

Standard InChI Key:  OTWREUREVAYHLP-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 28 29  0  0  0  0  0  0  0  0999 V2000
   16.2950  -10.7619    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.7662  -10.0847    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.9427  -10.0144    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   13.8026  -10.4331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8014  -11.2605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5162  -11.6733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2327  -11.2600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2298  -10.4295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5144  -10.0204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5120   -9.1954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2251   -8.7808    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.7962   -8.7850    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.9396   -9.1894    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.6525   -8.7741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3685   -9.1840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3716  -10.0090    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.0814   -8.7688    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.7974   -9.1786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7959  -10.0009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5111  -10.4107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2250   -9.9955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2192   -9.1662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5034   -8.7602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9415  -10.4042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.7938   -7.9600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5070   -7.5454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5045   -6.7204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2177   -6.3058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  3  2  2  0
  1  3  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  9 10  1  0
 10 11  2  0
 10 12  1  0
  8  3  1  0
  3 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 15 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 21 24  1  0
 12 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4757750

    ---

Associated Targets(Human)

Hepatocyte (2737 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 405.48Molecular Weight (Monoisotopic): 405.1358AlogP: 1.84#Rotatable Bonds: 9
Polar Surface Area: 124.60Molecular Species: NEUTRALHBA: 5HBD: 4
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 9.13CX Basic pKa: CX LogP: 1.81CX LogD: 1.80
Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.37Np Likeness Score: -1.53

References

1. Bazan HA,Bhattacharjee S,Burgos C,Recio J,Abet V,Pahng AR,Jun B,Heap J,Ledet AJ,Gordon WC,Edwards S,Paul D,Alvarez-Builla J,Bazan NG.  (2020)  A novel pipeline of 2-(benzenesulfonamide)-N-(4-hydroxyphenyl) acetamide analgesics that lack hepatotoxicity and retain antipyresis.,  202  [PMID:32629335] [10.1016/j.ejmech.2020.112600]

Source