The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(2-((5-((2,6-dichloro-3,5-dimethoxybenzyl)oxy)pyrimidin-2-yl)amino)-3-methylphenyl)-2-fluoroacryl amide ID: ALA4757810
PubChem CID: 155884458
Max Phase: Preclinical
Molecular Formula: C23H21Cl2FN4O4
Molecular Weight: 507.35
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C=C(F)C(=O)Nc1cccc(C)c1Nc1ncc(OCc2c(Cl)c(OC)cc(OC)c2Cl)cn1
Standard InChI: InChI=1S/C23H21Cl2FN4O4/c1-12-6-5-7-16(29-22(31)13(2)26)21(12)30-23-27-9-14(10-28-23)34-11-15-19(24)17(32-3)8-18(33-4)20(15)25/h5-10H,2,11H2,1,3-4H3,(H,29,31)(H,27,28,30)
Standard InChI Key: GRLPJXHTSUIFNY-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 36 0 0 0 0 0 0 0 0999 V2000
18.6947 -20.8543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6935 -21.6818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4083 -22.0946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1247 -21.6813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1219 -20.8507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4065 -20.4416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4040 -19.6166 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.1173 -19.2020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8308 -19.6147 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.5436 -19.2008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5416 -18.3749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8208 -17.9648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1111 -18.3810 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.2543 -17.9593 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.9705 -18.3687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6833 -17.9531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3967 -18.3637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1089 -17.9488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1058 -17.1230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3845 -16.7137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6753 -17.1310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8249 -18.3586 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.3780 -15.8887 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.0893 -15.4706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5378 -17.9434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3988 -19.1888 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
22.9571 -16.7249 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
20.8349 -20.4356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9801 -20.4420 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.2656 -20.8547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5511 -20.4424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2658 -21.6798 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.5509 -19.6174 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
15.8367 -20.8550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
11 14 1 0
14 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
18 22 1 0
20 23 1 0
23 24 1 0
22 25 1 0
17 26 1 0
21 27 1 0
5 28 1 0
1 29 1 0
29 30 1 0
30 31 1 0
30 32 2 0
31 33 1 0
31 34 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 507.35Molecular Weight (Monoisotopic): 506.0924AlogP: 5.85#Rotatable Bonds: 9Polar Surface Area: 94.60Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.86CX Basic pKa: 1.76CX LogP: 5.06CX LogD: 5.06Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.35Np Likeness Score: -0.78
References 1. Deng W,Chen X,Jiang K,Song X,Huang M,Tu ZC,Zhang Z,Lin X,Ortega R,Patterson AV,Smaill JB,Ding K,Chen S,Chen Y,Lu X. (2021) Investigation of Covalent Warheads in the Design of 2-Aminopyrimidine-based FGFR4 Inhibitors., 12 (4.0): [PMID:33859803 ] [10.1021/acsmedchemlett.1c00052 ]