4-((R)-2-((R)-2-((S)-2-acetamido-3-(benzyloxy)propanamido)-4-phenylbutanamido)-3-(hydroxyamino)-3-oxopropyl)phenyl acetate

ID: ALA4757848

PubChem CID: 162656182

Max Phase: Preclinical

Molecular Formula: C33H38N4O8

Molecular Weight: 618.69

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)N[C@@H](COCc1ccccc1)C(=O)N[C@H](CCc1ccccc1)C(=O)N[C@H](Cc1ccc(OC(C)=O)cc1)C(=O)NO

Standard InChI:  InChI=1S/C33H38N4O8/c1-22(38)34-30(21-44-20-26-11-7-4-8-12-26)32(41)35-28(18-15-24-9-5-3-6-10-24)31(40)36-29(33(42)37-43)19-25-13-16-27(17-14-25)45-23(2)39/h3-14,16-17,28-30,43H,15,18-21H2,1-2H3,(H,34,38)(H,35,41)(H,36,40)(H,37,42)/t28-,29-,30+/m1/s1

Standard InChI Key:  RDYRBZQBYHYZNW-OCBJUFRSSA-N

Molfile:  

 
     RDKit          2D

 45 47  0  0  0  0  0  0  0  0999 V2000
   18.3331  -17.6873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0476  -17.2748    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.6187  -17.2748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3331  -18.5123    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.7620  -17.6873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4765  -17.2748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1910  -17.6873    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.4765  -16.4498    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.9054  -17.2748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6200  -17.6873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9054  -16.4498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6200  -18.5123    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.3344  -17.2748    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.0489  -17.6873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7633  -17.2748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0489  -18.5123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7633  -18.9248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4778  -17.6873    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.1922  -17.2748    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.7633  -16.4498    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.7595  -19.7508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4730  -20.1632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1885  -19.7507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1859  -18.9215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4716  -18.5128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7620  -18.5123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4765  -18.9248    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.4765  -19.7498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1910  -20.1623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1886  -20.9883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9023  -21.4007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6177  -20.9882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6151  -20.1590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9009  -19.7502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6200  -16.0373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6200  -15.2123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3363  -14.8011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3367  -13.9769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6217  -13.5635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9049  -13.9805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9080  -14.8034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9036  -20.1623    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.9047  -20.9872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6196  -21.3988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1907  -21.4007    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  1  0
  1  4  2  0
  2  5  1  0
  5  6  1  0
  6  7  1  0
  6  8  2  0
  7  9  1  0
  9 10  1  0
  9 11  1  6
 10 12  2  0
 10 13  1  0
 13 14  1  0
 14 15  1  0
 14 16  1  1
 16 17  1  0
 15 18  1  0
 18 19  1  0
 15 20  2  0
 17 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 17  1  0
  5 26  1  6
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 29  1  0
 11 35  1  0
 35 36  1  0
 36 37  2  0
 37 38  1  0
 38 39  2  0
 39 40  1  0
 40 41  2  0
 41 36  1  0
 23 42  1  0
 42 43  1  0
 43 44  1  0
 43 45  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4757848

    ---

Associated Targets(Human)

MMP12 Tchem Matrix metalloproteinase 12 (1130 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 618.69Molecular Weight (Monoisotopic): 618.2690AlogP: 1.98#Rotatable Bonds: 16
Polar Surface Area: 172.16Molecular Species: NEUTRALHBA: 8HBD: 5
#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 5#RO5 Violations (Lipinski): 2
CX Acidic pKa: 8.72CX Basic pKa: CX LogP: 2.04CX LogD: 2.02
Aromatic Rings: 3Heavy Atoms: 45QED Weighted: 0.07Np Likeness Score: 0.02

References

1. Baggio C,Velazquez JV,Fragai M,Nordgren TM,Pellecchia M.  (2020)  Therapeutic Targeting of MMP-12 for the Treatment of Chronic Obstructive Pulmonary Disease.,  63  (21): [PMID:33107733] [10.1021/acs.jmedchem.0c01285]

Source