methyl 4-(4-(bis(4-chlorophenyl)methyl)piperazin-1-yl)-4-oxobut-2-enoate

ID: ALA4758051

PubChem CID: 162657017

Max Phase: Preclinical

Molecular Formula: C22H22Cl2N2O3

Molecular Weight: 433.34

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COC(=O)/C=C/C(=O)N1CCN(C(c2ccc(Cl)cc2)c2ccc(Cl)cc2)CC1

Standard InChI:  InChI=1S/C22H22Cl2N2O3/c1-29-21(28)11-10-20(27)25-12-14-26(15-13-25)22(16-2-6-18(23)7-3-16)17-4-8-19(24)9-5-17/h2-11,22H,12-15H2,1H3/b11-10+

Standard InChI Key:  MJPJVSGWICKDQC-ZHACJKMWSA-N

Molfile:  

 
     RDKit          2D

 29 31  0  0  0  0  0  0  0  0999 V2000
   39.6455  -26.5741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.2308  -25.8588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.2308  -27.2893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.6473  -25.1459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.2333  -24.4312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4072  -24.4307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9968  -25.1510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4090  -25.8628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4064  -27.2866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9959  -28.0010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4066  -28.7172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.2360  -28.7146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.6470  -27.9996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9957  -23.7161    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   37.9969  -29.4288    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   40.4707  -26.5741    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.8813  -27.2893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.8813  -25.8588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.7065  -25.8588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.1213  -26.5741    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   42.9465  -26.5741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.7065  -27.2893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.3571  -25.8588    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   43.3571  -27.2893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.1782  -27.2914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.5870  -28.0035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.4081  -28.0056    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   44.1746  -28.7136    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   45.8168  -28.7177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  1  0
  2  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  2  1  0
  3  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  3  1  0
  6 14  1  0
 11 15  1  0
  1 16  1  0
 16 17  1  0
 16 18  1  0
 18 19  1  0
 17 22  1  0
 19 20  1  0
 20 21  1  0
 20 22  1  0
 21 23  2  0
 21 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  1  0
 26 28  2  0
 27 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4758051

    ---

Associated Targets(Human)

GPX4 Tchem Phospholipid hydroperoxide glutathione peroxidase (167 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 433.34Molecular Weight (Monoisotopic): 432.1007AlogP: 3.96#Rotatable Bonds: 5
Polar Surface Area: 49.85Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 5.62CX LogP: 4.54CX LogD: 4.54
Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.53Np Likeness Score: -0.70

References

1. Eaton JK,Furst L,Cai LL,Viswanathan VS,Schreiber SL.  (2020)  Structure-activity relationships of GPX4 inhibitor warheads.,  30  (23.0): [PMID:32920142] [10.1016/j.bmcl.2020.127538]

Source