7-{[3-(4-Flourophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methoxy}-4-methyl-2H-chromen-2-one

ID: ALA4758100

PubChem CID: 162656376

Max Phase: Preclinical

Molecular Formula: C20H16FNO4

Molecular Weight: 353.35

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1cc(=O)oc2cc(OCC3CC(c4ccc(F)cc4)=NO3)ccc12

Standard InChI:  InChI=1S/C20H16FNO4/c1-12-8-20(23)25-19-10-15(6-7-17(12)19)24-11-16-9-18(22-26-16)13-2-4-14(21)5-3-13/h2-8,10,16H,9,11H2,1H3

Standard InChI Key:  SVFCEWYPNXBHSW-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 26 29  0  0  0  0  0  0  0  0999 V2000
   35.8601  -19.9923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8589  -20.8118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5670  -21.2208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5652  -19.5834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2738  -19.9887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2746  -20.8077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9831  -21.2147    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.6914  -20.8039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6866  -19.9818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9775  -19.5784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9732  -18.7612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4006  -21.2098    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.1509  -21.2198    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.4435  -20.8107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7355  -21.2187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9926  -20.8880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4453  -21.4949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8534  -22.2030    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.6528  -22.0336    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.6358  -21.4084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3048  -20.6601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4929  -20.5737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0112  -21.2349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3471  -21.9845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1580  -22.0673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1984  -21.1500    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
 10 11  1  0
  8 12  2  0
  2 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 15  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 17 20  1  0
 23 26  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4758100

    ---

Associated Targets(Human)

UACC-903 (393 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 353.35Molecular Weight (Monoisotopic): 353.1063AlogP: 3.81#Rotatable Bonds: 4
Polar Surface Area: 61.03Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 2.24CX LogP: 3.81CX LogD: 3.81
Aromatic Rings: 3Heavy Atoms: 26QED Weighted: 0.67Np Likeness Score: -0.80

References

1. Lingaraju GS,Balaji KS,Jayarama S,Anil SM,Kiran KR,Sadashiva MP.  (2018)  Synthesis of new coumarin tethered isoxazolines as potential anticancer agents.,  28  (23-24): [PMID:30396758] [10.1016/j.bmcl.2018.10.046]

Source