(R,E)-N-(4-(3-(5-((5-tert-butyloxazol-2-yl)methylthio)thiazol-2-ylamino)pyrrolidine-1-carbonyl)phenyl)-4-(dimethylamino)but-2-enamide

ID: ALA4758168

PubChem CID: 145749897

Max Phase: Preclinical

Molecular Formula: C28H36N6O3S2

Molecular Weight: 568.77

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CN(C)C/C=C/C(=O)Nc1ccc(C(=O)N2CC[C@@H](Nc3ncc(SCc4ncc(C(C)(C)C)o4)s3)C2)cc1

Standard InChI:  InChI=1S/C28H36N6O3S2/c1-28(2,3)22-15-29-24(37-22)18-38-25-16-30-27(39-25)32-21-12-14-34(17-21)26(36)19-8-10-20(11-9-19)31-23(35)7-6-13-33(4)5/h6-11,15-16,21H,12-14,17-18H2,1-5H3,(H,30,32)(H,31,35)/b7-6+/t21-/m1/s1

Standard InChI Key:  ZXWDEAQOOQXIND-IRUYWQDXSA-N

Molfile:  

 
     RDKit          2D

 39 42  0  0  0  0  0  0  0  0999 V2000
   23.3086   -7.1474    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.0147   -6.7361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7602   -7.0641    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   25.3047   -6.4547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8934   -5.7485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0948   -5.9215    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.1155   -6.5337    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   26.4493   -7.2806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2621   -7.3649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6725   -8.0693    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.4716   -7.8983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5559   -7.0854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8089   -6.7542    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.0797   -8.4443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9109   -9.2438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6541   -7.8582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7821   -8.8488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5993   -6.7415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5093   -5.9323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7093   -5.7654    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.3034   -6.4747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8525   -7.0799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3741   -5.0202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8520   -4.3572    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.5611   -4.9378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2280   -4.1922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4157   -4.1096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9370   -4.7730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2764   -5.5210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0876   -5.6001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1239   -4.6917    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.7877   -3.9469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9746   -3.8656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2647   -3.2833    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.6384   -3.1208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8252   -3.0395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4891   -2.2946    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.9660   -1.6311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6759   -2.2134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  2  2  0
  7  8  1  0
  4  7  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13  9  2  0
 11 14  1  0
 14 15  1  0
 14 16  1  0
 14 17  1  0
 18  1  1  6
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 18  1  0
 20 23  1  0
 23 24  2  0
 23 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
 28 31  1  0
 31 32  1  0
 32 33  1  0
 32 34  2  0
 33 35  2  0
 35 36  1  0
 36 37  1  0
 37 38  1  0
 37 39  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4758168

    ---

Associated Targets(Human)

CDK2 Tchem Cyclin-dependent kinase 2 (9050 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CDK7 Tchem Cyclin-dependent kinase 7 (1512 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CDK9 Tchem Cyclin-dependent kinase 9 (2495 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 568.77Molecular Weight (Monoisotopic): 568.2290AlogP: 5.10#Rotatable Bonds: 10
Polar Surface Area: 103.60Molecular Species: BASEHBA: 9HBD: 2
#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 13.90CX Basic pKa: 8.81CX LogP: 3.33CX LogD: 1.91
Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.26Np Likeness Score: -1.63

References

1.  (2020)  Inhibitors of cyclin-dependent kinases, 

Source