The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-3-(3-(5-guanidinopentyl)ureido)-2-((S)-1-(phenylsulfonyl)pyrrolidine-2-carboxamido)propanoic acid ID: ALA4758256
PubChem CID: 131965410
Max Phase: Preclinical
Molecular Formula: C21H33N7O6S
Molecular Weight: 511.61
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: N=C(N)NCCCCCNC(=O)NC[C@H](NC(=O)[C@@H]1CCCN1S(=O)(=O)c1ccccc1)C(=O)O
Standard InChI: InChI=1S/C21H33N7O6S/c22-20(23)24-11-5-2-6-12-25-21(32)26-14-16(19(30)31)27-18(29)17-10-7-13-28(17)35(33,34)15-8-3-1-4-9-15/h1,3-4,8-9,16-17H,2,5-7,10-14H2,(H,27,29)(H,30,31)(H4,22,23,24)(H2,25,26,32)/t16-,17-/m0/s1
Standard InChI Key: ZEDVVTNZWFMRKR-IRXDYDNUSA-N
Molfile:
RDKit 2D
35 36 0 0 0 0 0 0 0 0999 V2000
19.5713 -2.4309 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.3608 -3.2234 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
20.1523 -3.0094 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.5289 -4.3465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2392 -3.9352 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.9526 -4.3411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6629 -3.9299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3762 -4.3358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0865 -3.9245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7999 -4.3305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5061 -3.9192 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.2194 -4.3251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9297 -3.9139 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.2225 -5.1464 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.5299 -5.1637 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.8207 -3.9387 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.1135 -4.3482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4053 -3.9405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6981 -4.3500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.4043 -3.1233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1115 -2.7138 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.6961 -2.7156 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.9899 -3.9422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2827 -4.3517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9889 -3.1251 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.5365 -4.0226 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.9905 -4.6305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4000 -5.3378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1990 -5.1668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5870 -2.9729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4217 -2.1767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6487 -1.9262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0439 -2.4713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2174 -3.2703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9902 -3.5172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
12 14 2 0
4 15 2 0
4 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
18 20 1 6
20 21 2 0
20 22 1 0
19 23 1 0
24 23 1 6
23 25 2 0
24 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 24 1 0
26 2 1 0
2 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 511.61Molecular Weight (Monoisotopic): 511.2213AlogP: -0.64#Rotatable Bonds: 13Polar Surface Area: 206.81Molecular Species: ZWITTERIONHBA: 6HBD: 7#RO5 Violations: 2HBA (Lipinski): 13HBD (Lipinski): 8#RO5 Violations (Lipinski): 3CX Acidic pKa: 3.27CX Basic pKa: 12.03CX LogP: -2.61CX LogD: -2.61Aromatic Rings: 1Heavy Atoms: 35QED Weighted: 0.10Np Likeness Score: -0.97
References 1. Sundaram A,Chen C,Isik Reed N,Liu S,Ki Yeon S,McIntosh J,Tang YZ,Yang H,Adler M,Beresis R,Seiple IB,Sheppard D,DeGrado WF,Jo H. (2020) Dual antagonists of α5β1/αvβ1 integrin for airway hyperresponsiveness., 30 (22): [PMID:33007395 ] [10.1016/j.bmcl.2020.127578 ]