(S)-3-(3-(5-guanidinopentyl)ureido)-2-((S)-1-(phenylsulfonyl)pyrrolidine-2-carboxamido)propanoic acid

ID: ALA4758256

PubChem CID: 131965410

Max Phase: Preclinical

Molecular Formula: C21H33N7O6S

Molecular Weight: 511.61

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  N=C(N)NCCCCCNC(=O)NC[C@H](NC(=O)[C@@H]1CCCN1S(=O)(=O)c1ccccc1)C(=O)O

Standard InChI:  InChI=1S/C21H33N7O6S/c22-20(23)24-11-5-2-6-12-25-21(32)26-14-16(19(30)31)27-18(29)17-10-7-13-28(17)35(33,34)15-8-3-1-4-9-15/h1,3-4,8-9,16-17H,2,5-7,10-14H2,(H,27,29)(H,30,31)(H4,22,23,24)(H2,25,26,32)/t16-,17-/m0/s1

Standard InChI Key:  ZEDVVTNZWFMRKR-IRXDYDNUSA-N

Molfile:  

 
     RDKit          2D

 35 36  0  0  0  0  0  0  0  0999 V2000
   19.5713   -2.4309    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.3608   -3.2234    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   20.1523   -3.0094    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.5289   -4.3465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2392   -3.9352    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.9526   -4.3411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6629   -3.9299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3762   -4.3358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0865   -3.9245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7999   -4.3305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5061   -3.9192    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.2194   -4.3251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9297   -3.9139    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.2225   -5.1464    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.5299   -5.1637    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.8207   -3.9387    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.1135   -4.3482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4053   -3.9405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6981   -4.3500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.4043   -3.1233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1115   -2.7138    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.6961   -2.7156    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.9899   -3.9422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2827   -4.3517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9889   -3.1251    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.5365   -4.0226    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.9905   -4.6305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4000   -5.3378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1990   -5.1668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5870   -2.9729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4217   -2.1767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6487   -1.9262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0439   -2.4713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2174   -3.2703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9902   -3.5172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 12 14  2  0
  4 15  2  0
  4 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 18 20  1  6
 20 21  2  0
 20 22  1  0
 19 23  1  0
 24 23  1  6
 23 25  2  0
 24 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 24  1  0
 26  2  1  0
  2 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4758256

    ---

Associated Targets(Human)

ITGB1 Tclin Integrin alpha-5/beta-1 (686 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ITGB1 Tclin Integrin alpha-V/beta-1 (222 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ITGB3 Tclin Integrin alpha-V/beta-3 (2708 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 511.61Molecular Weight (Monoisotopic): 511.2213AlogP: -0.64#Rotatable Bonds: 13
Polar Surface Area: 206.81Molecular Species: ZWITTERIONHBA: 6HBD: 7
#RO5 Violations: 2HBA (Lipinski): 13HBD (Lipinski): 8#RO5 Violations (Lipinski): 3
CX Acidic pKa: 3.27CX Basic pKa: 12.03CX LogP: -2.61CX LogD: -2.61
Aromatic Rings: 1Heavy Atoms: 35QED Weighted: 0.10Np Likeness Score: -0.97

References

1. Sundaram A,Chen C,Isik Reed N,Liu S,Ki Yeon S,McIntosh J,Tang YZ,Yang H,Adler M,Beresis R,Seiple IB,Sheppard D,DeGrado WF,Jo H.  (2020)  Dual antagonists of α5β1/αvβ1 integrin for airway hyperresponsiveness.,  30  (22): [PMID:33007395] [10.1016/j.bmcl.2020.127578]

Source