(3S,6S,9S,12S,15S)-3-(4-aminobutyl)-6-benzyl-12-(hydroxymethyl)-9-[(4-hydroxyphenyl)methyl]-15-methyl-1,4,7,10,13-pentazacyclopentadecane-2,5,8,11,14-pentone

ID: ALA4758278

PubChem CID: 162657023

Max Phase: Preclinical

Molecular Formula: C30H40N6O7

Molecular Weight: 596.68

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C[C@@H]1NC(=O)[C@H](CCCCN)NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@H](Cc2ccc(O)cc2)NC(=O)[C@H](CO)NC1=O

Standard InChI:  InChI=1S/C30H40N6O7/c1-18-26(39)36-25(17-37)30(43)35-24(16-20-10-12-21(38)13-11-20)29(42)34-23(15-19-7-3-2-4-8-19)28(41)33-22(27(40)32-18)9-5-6-14-31/h2-4,7-8,10-13,18,22-25,37-38H,5-6,9,14-17,31H2,1H3,(H,32,40)(H,33,41)(H,34,42)(H,35,43)(H,36,39)/t18-,22-,23-,24-,25-/m0/s1

Standard InChI Key:  MUQUCDGUXQHFAN-WCJQXVFBSA-N

Molfile:  

 
     RDKit          2D

 43 45  0  0  0  0  0  0  0  0999 V2000
    3.8767   -4.6307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5513   -4.2332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2236   -4.6228    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.5468   -3.4558    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.8957   -4.2268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5763   -4.6164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5767   -5.3927    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.2442   -4.2203    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2491   -5.7823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2535   -6.5596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9341   -6.9451    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8812   -5.4080    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.1898   -4.2404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1855   -3.4608    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.8918   -3.4500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9258   -5.3859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5639   -3.0583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2420   -3.4490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9179   -3.0579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9144   -2.2762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2256   -1.8914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5607   -2.2846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5867   -1.8791    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.6024   -5.7752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6029   -6.5525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2746   -6.9375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9522   -6.5453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9458   -5.7641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2652   -5.3782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5850   -6.9518    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.5891   -7.7333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9124   -8.1255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9206   -8.9029    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0141   -7.8477    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.2046   -5.8047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2132   -6.5862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5278   -5.4198    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5363   -6.9740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2644   -8.1215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9408   -7.7282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6202   -8.1164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2925   -7.7231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9719   -8.1112    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  2  0
  3  5  1  0
  5  6  1  0
  6  7  1  0
  6  8  2  0
  7  9  1  0
  9 10  1  0
 10 11  2  0
  1 12  1  0
  1 13  1  1
 13 14  1  0
  5 15  1  1
  9 16  1  1
 15 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 20 23  1  0
 16 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 10 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  2  0
 32 34  1  0
 12 35  1  0
 35 36  1  0
 35 37  2  0
 36 34  1  0
 36 38  1  1
 31 39  1  1
 39 40  1  0
 40 41  1  0
 41 42  1  0
 42 43  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4758278

    ---

Associated Targets(Human)

HSP90AB1 Tchem Heat shock protein HSP 90-beta (1689 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 596.68Molecular Weight (Monoisotopic): 596.2958AlogP: -1.24#Rotatable Bonds: 9
Polar Surface Area: 211.98Molecular Species: BASEHBA: 8HBD: 8
#RO5 Violations: 2HBA (Lipinski): 13HBD (Lipinski): 9#RO5 Violations (Lipinski): 3
CX Acidic pKa: 9.35CX Basic pKa: 10.06CX LogP: -1.82CX LogD: -3.31
Aromatic Rings: 2Heavy Atoms: 43QED Weighted: 0.16Np Likeness Score: 1.00

References

1. Rahimi MN,Buckton LK,Zaiter SS,Kho J,Chan V,Guo A,Konesan J,Kwon S,Lam LKO,Lawler MF,Leong M,Moldovan GD,Neale DA,Thornton G,McAlpine SR.  (2018)  Synthesis and Structure-Activity Relationships of Inhibitors That Target the C-Terminal MEEVD on Heat Shock Protein 90.,  (2): [PMID:30555625] [10.1021/acsmedchemlett.7b00310]

Source