The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-N-(2-(2-cyano-4,4-difluoropyrrolidin-1-yl)-2-oxoethyl)-2-((4-(trifluoromethyl)phenylsulfonyl)methyl)thiazole-4-carboxamide ID: ALA4758299
PubChem CID: 155755014
Max Phase: Preclinical
Molecular Formula: C19H15F5N4O4S2
Molecular Weight: 522.48
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: N#C[C@@H]1CC(F)(F)CN1C(=O)CNC(=O)c1csc(CS(=O)(=O)c2ccc(C(F)(F)F)cc2)n1
Standard InChI: InChI=1S/C19H15F5N4O4S2/c20-18(21)5-12(6-25)28(10-18)16(29)7-26-17(30)14-8-33-15(27-14)9-34(31,32)13-3-1-11(2-4-13)19(22,23)24/h1-4,8,12H,5,7,9-10H2,(H,26,30)/t12-/m0/s1
Standard InChI Key: NFVMOVDFHPHEHQ-LBPRGKRZSA-N
Molfile:
RDKit 2D
34 36 0 0 0 0 0 0 0 0999 V2000
3.5077 -2.9140 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.3367 -2.9114 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.9200 -2.1947 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.0378 -3.1568 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
11.6828 -3.9020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5057 -3.8369 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
9.6323 -4.4746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4548 -4.4108 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.9854 -5.0388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7480 -4.7239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8822 -3.7079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7903 -5.8404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5965 -6.6409 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.1658 -3.7942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2762 -5.2189 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.3432 -3.8580 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.8767 -3.1775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0542 -3.2413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2327 -2.4333 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.5167 -2.6159 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.7541 -2.9308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8179 -3.7534 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
6.6199 -3.9467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3163 -3.7352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5903 -4.1237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5674 -4.9476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2709 -5.3803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9988 -4.9831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0181 -4.1604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2494 -6.2050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5245 -6.5988 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.9529 -6.6359 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.2423 -7.0332 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.0512 -2.4989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
5 4 1 0
6 5 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 5 1 0
5 11 1 0
11 8 1 0
9 12 1 1
12 13 3 0
7 14 1 0
7 15 2 0
14 16 1 0
16 17 1 0
17 18 1 0
17 19 2 0
18 20 1 0
20 21 2 0
21 22 1 0
22 23 1 0
23 18 2 0
21 34 1 0
2 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
27 30 1 0
30 31 1 0
30 32 1 0
30 33 1 0
2 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 522.48Molecular Weight (Monoisotopic): 522.0455AlogP: 2.63#Rotatable Bonds: 6Polar Surface Area: 120.23Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.80CX Basic pKa: ┄CX LogP: 1.73CX LogD: 1.73Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.58Np Likeness Score: -1.61
References 1. Jung HJ,Nam EH,Park JY,Ghosh P,Kim IS. (2021) Identification of BR102910 as a selective fibroblast activation protein (FAP) inhibitor., 37 [PMID:33571650 ] [10.1016/j.bmcl.2021.127846 ]