The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(2-(allyloxy)benzyl)-N-(benzo[d][1,3]dioxol-5-yl)-5-methyl-4-nitroisoxazole-3-carboxamide ID: ALA4758354
PubChem CID: 162656450
Max Phase: Preclinical
Molecular Formula: C22H19N3O7
Molecular Weight: 437.41
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=CCOc1ccccc1CN(C(=O)c1noc(C)c1[N+](=O)[O-])c1ccc2c(c1)OCO2
Standard InChI: InChI=1S/C22H19N3O7/c1-3-10-29-17-7-5-4-6-15(17)12-24(16-8-9-18-19(11-16)31-13-30-18)22(26)20-21(25(27)28)14(2)32-23-20/h3-9,11H,1,10,12-13H2,2H3
Standard InChI Key: ZRKXLKUYGQJJMY-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
30.3002 -14.3002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0147 -13.8878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7292 -14.3002 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.4436 -13.8878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1581 -14.3002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4436 -13.0628 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.7292 -15.1253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0127 -15.5366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4442 -16.3572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4410 -15.5342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5859 -13.8852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8720 -14.2970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8715 -15.1229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5910 -15.5353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3020 -15.1211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5872 -13.0602 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.8735 -12.6466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1583 -13.0579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4445 -12.6442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7273 -16.7741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0128 -16.3584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3964 -16.9095 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.7302 -17.6660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5527 -17.5822 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.2485 -15.1167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.0555 -15.2882 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.4680 -14.5736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9159 -13.9607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2885 -14.4874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0868 -13.1491 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.4730 -12.5978 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.8711 -12.8931 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
4 6 2 0
3 7 1 0
7 8 2 0
8 21 1 0
20 9 1 0
9 10 2 0
10 7 1 0
1 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 1 1 0
11 16 1 0
16 17 1 0
17 18 1 0
18 19 2 0
20 21 2 0
21 22 1 0
22 23 1 0
23 24 1 0
24 20 1 0
5 25 2 0
25 26 1 0
26 27 1 0
27 28 2 0
28 5 1 0
27 29 1 0
30 31 2 0
30 32 1 0
28 30 1 0
M CHG 2 30 1 32 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 437.41Molecular Weight (Monoisotopic): 437.1223AlogP: 4.03#Rotatable Bonds: 8Polar Surface Area: 117.17Molecular Species: NEUTRALHBA: 8HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 3.74CX LogD: 3.74Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.29Np Likeness Score: -1.38
References 1. Eaton JK,Furst L,Cai LL,Viswanathan VS,Schreiber SL. (2020) Structure-activity relationships of GPX4 inhibitor warheads., 30 (23.0): [PMID:32920142 ] [10.1016/j.bmcl.2020.127538 ]