N-(2-(allyloxy)benzyl)-N-(benzo[d][1,3]dioxol-5-yl)-5-methyl-4-nitroisoxazole-3-carboxamide

ID: ALA4758354

PubChem CID: 162656450

Max Phase: Preclinical

Molecular Formula: C22H19N3O7

Molecular Weight: 437.41

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C=CCOc1ccccc1CN(C(=O)c1noc(C)c1[N+](=O)[O-])c1ccc2c(c1)OCO2

Standard InChI:  InChI=1S/C22H19N3O7/c1-3-10-29-17-7-5-4-6-15(17)12-24(16-8-9-18-19(11-16)31-13-30-18)22(26)20-21(25(27)28)14(2)32-23-20/h3-9,11H,1,10,12-13H2,2H3

Standard InChI Key:  ZRKXLKUYGQJJMY-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
   30.3002  -14.3002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0147  -13.8878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7292  -14.3002    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.4436  -13.8878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1581  -14.3002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4436  -13.0628    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.7292  -15.1253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0127  -15.5366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4442  -16.3572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4410  -15.5342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5859  -13.8852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8720  -14.2970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8715  -15.1229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5910  -15.5353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3020  -15.1211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5872  -13.0602    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.8735  -12.6466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1583  -13.0579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4445  -12.6442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7273  -16.7741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0128  -16.3584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3964  -16.9095    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.7302  -17.6660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5527  -17.5822    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.2485  -15.1167    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.0555  -15.2882    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.4680  -14.5736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9159  -13.9607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2885  -14.4874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0868  -13.1491    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.4730  -12.5978    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.8711  -12.8931    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  4  6  2  0
  3  7  1  0
  7  8  2  0
  8 21  1  0
 20  9  1  0
  9 10  2  0
 10  7  1  0
  1 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15  1  1  0
 11 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  2  0
 20 21  2  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 20  1  0
  5 25  2  0
 25 26  1  0
 26 27  1  0
 27 28  2  0
 28  5  1  0
 27 29  1  0
 30 31  2  0
 30 32  1  0
 28 30  1  0
M  CHG  2  30   1  32  -1
M  END

Alternative Forms

  1. Parent:

    ALA4758354

    ---

Associated Targets(Human)

GPX4 Tchem Phospholipid hydroperoxide glutathione peroxidase (167 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 437.41Molecular Weight (Monoisotopic): 437.1223AlogP: 4.03#Rotatable Bonds: 8
Polar Surface Area: 117.17Molecular Species: NEUTRALHBA: 8HBD:
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.74CX LogD: 3.74
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.29Np Likeness Score: -1.38

References

1. Eaton JK,Furst L,Cai LL,Viswanathan VS,Schreiber SL.  (2020)  Structure-activity relationships of GPX4 inhibitor warheads.,  30  (23.0): [PMID:32920142] [10.1016/j.bmcl.2020.127538]

Source