4-(2,4-difluoro-3'-(hydroxymethyl)-[1,1'-biphenyl]-3-carboxamido)-N-(4-fluorophenyl)-1H-pyrazole-3-carboxamide

ID: ALA4758499

PubChem CID: 162656458

Max Phase: Preclinical

Molecular Formula: C24H17F3N4O3

Molecular Weight: 466.42

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(Nc1ccc(F)cc1)c1n[nH]cc1NC(=O)c1c(F)ccc(-c2cccc(CO)c2)c1F

Standard InChI:  InChI=1S/C24H17F3N4O3/c25-15-4-6-16(7-5-15)29-24(34)22-19(11-28-31-22)30-23(33)20-18(26)9-8-17(21(20)27)14-3-1-2-13(10-14)12-32/h1-11,32H,12H2,(H,28,31)(H,29,34)(H,30,33)

Standard InChI Key:  XQGRRZAMCBAEKL-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
   33.5901  -22.2045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5890  -23.0240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2970  -23.4330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0067  -23.0235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0038  -22.2009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2952  -21.7956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7150  -23.4310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7163  -24.2482    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.4221  -23.0213    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.1304  -23.4288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2153  -24.2394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0149  -24.4081    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.4224  -23.6997    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.8745  -23.0934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0419  -22.2935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.8183  -22.0385    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.4329  -21.7486    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.7100  -21.7896    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   37.6003  -20.9487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3760  -20.6981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.5435  -19.8991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9342  -19.3533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1546  -19.6121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9907  -20.4105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.1005  -18.5532    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   34.2968  -24.2501    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   32.8828  -23.4323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1751  -23.0214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4676  -23.4288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4665  -24.2469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1789  -24.6559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8835  -24.2461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7604  -23.0193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7615  -22.2021    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  4  7  1  0
  7  8  2  0
  7  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 14 10  1  0
 14 15  1  0
 15 16  2  0
 15 17  1  0
  5 18  1  0
 17 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 22 25  1  0
  3 26  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
  2 27  1  0
 29 33  1  0
 33 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4758499

    ---

Associated Targets(Human)

CDK1 Tchem Cyclin-dependent kinase 1/cyclin B1 (1887 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CDK2 Tchem CDK2/Cyclin A2 (2260 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
A2058 (690 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 466.42Molecular Weight (Monoisotopic): 466.1253AlogP: 4.49#Rotatable Bonds: 6
Polar Surface Area: 107.11Molecular Species: NEUTRALHBA: 4HBD: 4
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 9.28CX Basic pKa: CX LogP: 4.16CX LogD: 4.15
Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.34Np Likeness Score: -1.29

References

1. Lin T,Li J,Liu L,Li Y,Jiang H,Chen K,Xu P,Luo C,Zhou B.  (2021)  Design, synthesis, and biological evaluation of 4-benzoylamino-1H-pyrazole-3-carboxamide derivatives as potent CDK2 inhibitors.,  215  [PMID:33611192] [10.1016/j.ejmech.2021.113281]

Source