The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-2-Amino-N-(2-(piperidin-1-yl)ethyl)-3-((5-(4-(trifluoromethyl)phenyl)-10,11-dihydro-5H-dibenzo[a,d][7]annulen-5-yl)thio)propanamide ID: ALA4758507
PubChem CID: 162656554
Max Phase: Preclinical
Molecular Formula: C32H36F3N3OS
Molecular Weight: 567.72
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: NC(CSC1(c2ccc(C(F)(F)F)cc2)c2ccccc2CCc2ccccc21)C(=O)NCCN1CCCCC1
Standard InChI: InChI=1S/C32H36F3N3OS/c33-32(34,35)26-16-14-25(15-17-26)31(40-22-29(36)30(39)37-18-21-38-19-6-1-7-20-38)27-10-4-2-8-23(27)12-13-24-9-3-5-11-28(24)31/h2-5,8-11,14-17,29H,1,6-7,12-13,18-22,36H2,(H,37,39)
Standard InChI Key: BWYPJCOCPYJHEK-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 44 0 0 0 0 0 0 0 0999 V2000
8.4352 -12.3768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1315 -12.7982 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
9.1522 -11.9813 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.8794 -9.5051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4520 -10.2017 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
7.2689 -10.2235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5177 -7.7042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3307 -7.7284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1508 -9.1329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9931 -8.3289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2194 -8.0651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6028 -8.6042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7650 -9.4104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5385 -9.6705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8247 -8.3782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6248 -9.1732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2127 -9.7417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0006 -9.5166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1974 -8.7177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6081 -8.1525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6351 -10.1798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2077 -10.8764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3908 -10.8546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5973 -11.5948 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0013 -10.1362 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9635 -11.5511 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.8381 -10.9188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2270 -11.6366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0447 -11.6589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4721 -10.9574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0808 -10.2424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0088 -13.0739 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.1466 -11.5293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7192 -12.2258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9023 -12.2018 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.5164 -11.4824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7031 -11.4566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2701 -12.1502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6565 -12.8715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4760 -12.8991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
1 3 1 0
5 4 1 0
4 6 1 0
7 8 1 0
8 15 1 0
7 10 1 0
16 4 1 0
9 4 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
5 21 1 0
21 22 1 0
22 23 1 0
22 24 1 0
23 25 2 0
23 26 1 0
6 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 6 1 0
29 1 1 0
1 32 1 0
26 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
35 40 1 0
36 37 1 0
37 38 1 0
38 39 1 0
39 40 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 567.72Molecular Weight (Monoisotopic): 567.2531AlogP: 5.76#Rotatable Bonds: 8Polar Surface Area: 58.36Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 8.47CX LogP: 6.43CX LogD: 4.98Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.36Np Likeness Score: -0.60
References 1. Fukai R,Ogo N,Ichida T,Yamane M,Sawada JI,Miyoshi N,Murakami H,Asai A. (2021) Design, synthesis, and evaluation of a novel prodrug, a S-trityl--cysteine derivative targeting kinesin spindle protein., 215 [PMID:33640763 ] [10.1016/j.ejmech.2021.113288 ]