(R)-2-Amino-N-(2-(piperidin-1-yl)ethyl)-3-((5-(4-(trifluoromethyl)phenyl)-10,11-dihydro-5H-dibenzo[a,d][7]annulen-5-yl)thio)propanamide

ID: ALA4758507

PubChem CID: 162656554

Max Phase: Preclinical

Molecular Formula: C32H36F3N3OS

Molecular Weight: 567.72

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  NC(CSC1(c2ccc(C(F)(F)F)cc2)c2ccccc2CCc2ccccc21)C(=O)NCCN1CCCCC1

Standard InChI:  InChI=1S/C32H36F3N3OS/c33-32(34,35)26-16-14-25(15-17-26)31(40-22-29(36)30(39)37-18-21-38-19-6-1-7-20-38)27-10-4-2-8-23(27)12-13-24-9-3-5-11-28(24)31/h2-5,8-11,14-17,29H,1,6-7,12-13,18-22,36H2,(H,37,39)

Standard InChI Key:  BWYPJCOCPYJHEK-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 40 44  0  0  0  0  0  0  0  0999 V2000
    8.4352  -12.3768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1315  -12.7982    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    9.1522  -11.9813    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    6.8794   -9.5051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4520  -10.2017    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    7.2689  -10.2235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5177   -7.7042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3307   -7.7284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1508   -9.1329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9931   -8.3289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2194   -8.0651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6028   -8.6042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7650   -9.4104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5385   -9.6705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8247   -8.3782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6248   -9.1732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2127   -9.7417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0006   -9.5166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1974   -8.7177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6081   -8.1525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6351  -10.1798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2077  -10.8764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3908  -10.8546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5973  -11.5948    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.0013  -10.1362    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9635  -11.5511    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.8381  -10.9188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2270  -11.6366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0447  -11.6589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4721  -10.9574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0808  -10.2424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0088  -13.0739    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.1466  -11.5293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7192  -12.2258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9023  -12.2018    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.5164  -11.4824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7031  -11.4566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2701  -12.1502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6565  -12.8715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4760  -12.8991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  1  3  1  0
  5  4  1  0
  4  6  1  0
  7  8  1  0
  8 15  1  0
  7 10  1  0
 16  4  1  0
  9  4  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
  5 21  1  0
 21 22  1  0
 22 23  1  0
 22 24  1  0
 23 25  2  0
 23 26  1  0
  6 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31  6  1  0
 29  1  1  0
  1 32  1  0
 26 33  1  0
 33 34  1  0
 34 35  1  0
 35 36  1  0
 35 40  1  0
 36 37  1  0
 37 38  1  0
 38 39  1  0
 39 40  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4758507

    ---

Associated Targets(Human)

KIF11 Tchem Kinesin-like protein 1 (1720 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HCT-116 (91556 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 567.72Molecular Weight (Monoisotopic): 567.2531AlogP: 5.76#Rotatable Bonds: 8
Polar Surface Area: 58.36Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 8.47CX LogP: 6.43CX LogD: 4.98
Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.36Np Likeness Score: -0.60

References

1. Fukai R,Ogo N,Ichida T,Yamane M,Sawada JI,Miyoshi N,Murakami H,Asai A.  (2021)  Design, synthesis, and evaluation of a novel prodrug, a S-trityl--cysteine derivative targeting kinesin spindle protein.,  215  [PMID:33640763] [10.1016/j.ejmech.2021.113288]

Source