(2R,4aR,4bR,6aR,6bS,8aS,12aS,14bR,16aS)-4a,6a,6b,11,11,14b-hexamethyl-2-((1R,2R,3S,4S)-1,2,3,4-tetrahydroxypentyl)-4a,4b,5,6,6a,6b,7,8,8a,9,10,11,12,12a,14,14a,14b,15,16,16a-icosahydro-4H-piceno[3,4-d][1,3]dioxine-8a-carboxylic acid

ID: ALA4758545

PubChem CID: 162656952

Max Phase: Preclinical

Molecular Formula: C36H58O8

Molecular Weight: 618.85

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C[C@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@@H]1OC[C@@]2(C)[C@@H]3CC[C@]4(C)[C@H](CC=C5[C@@H]6CC(C)(C)CC[C@]6(C(=O)O)CC[C@]54C)[C@@]3(C)CC[C@@H]2O1

Standard InChI:  InChI=1S/C36H58O8/c1-20(37)26(38)27(39)28(40)29-43-19-33(5)23-10-13-35(7)24(32(23,4)12-11-25(33)44-29)9-8-21-22-18-31(2,3)14-16-36(22,30(41)42)17-15-34(21,35)6/h8,20,22-29,37-40H,9-19H2,1-7H3,(H,41,42)/t20-,22-,23+,24+,25-,26-,27+,28+,29+,32-,33-,34+,35+,36-/m0/s1

Standard InChI Key:  AUWBWCSTYSRQBF-BKHNGHOOSA-N

Molfile:  

 
     RDKit          2D

 49 54  0  0  0  0  0  0  0  0999 V2000
    4.0906   -7.8485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5064   -6.2008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2258   -6.6216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6783   -4.1467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0926   -7.0284    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.5144   -5.3716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1079   -4.1621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7993   -5.7925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5521   -3.3748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8112   -4.5933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2219   -4.9633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2294   -5.7925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1234   -3.3401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9416   -6.2049    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.7993   -6.6216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2620   -2.2252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3767   -5.3924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8456   -2.9474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4289   -2.2277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1006   -4.9887    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.9542   -4.5501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4366   -7.4169    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.6616   -6.6277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6612   -5.8011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6529   -4.9717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3906   -4.5671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5107   -7.0297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5232   -5.0055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5302   -4.1983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9488   -5.3766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3683   -6.2176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0799   -5.8127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9417   -7.0348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5152   -7.8492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8016   -5.4165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8039   -8.2640    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0822   -6.2065    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.5223   -5.8286    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.2365   -4.5948    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3764   -8.2579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6649   -7.8440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9508   -8.2533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6675   -7.0210    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2393   -7.8396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5252   -8.2489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2418   -7.0164    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9482   -9.0764    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3738   -9.0810    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0864   -8.6716    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
 30 24  1  0
 15  5  1  0
  7 20  1  1
  8 15  1  0
 30 14  1  6
 26  4  2  0
 27  2  1  1
 24 17  1  0
 18 13  1  0
 27 15  1  0
 30 21  1  0
 35 10  1  0
  4 21  1  0
 16 18  1  0
  7 13  1  0
 10 29  1  0
 18 19  1  0
 12 11  1  1
 29  9  1  0
 17 32  1  0
 10 28  1  1
  3 22  1  6
 27 34  1  0
 12  3  1  0
 12  6  1  0
 32 35  1  0
 26 17  1  0
 33 23  1  0
 24 25  1  1
  7 10  1  0
 17 31  1  6
 36 34  1  0
 27  3  1  0
  8  6  1  0
  3 33  1  0
 23 24  1  0
  9 18  1  0
 26  7  1  0
 12 30  1  0
  5  1  1  0
  1 36  1  0
 15 37  1  6
 28 38  2  0
 28 39  1  0
  1 40  1  0
 40 41  1  0
 41 42  1  0
 41 43  1  1
 42 44  1  0
 44 45  1  0
 44 46  1  6
 42 47  1  1
 40 48  1  6
  1 49  1  6
M  END

Alternative Forms

  1. Parent:

    ALA4758545

    ---

Associated Targets(non-human)

Leishmania mexicana (936 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 618.85Molecular Weight (Monoisotopic): 618.4132AlogP: 5.06#Rotatable Bonds: 5
Polar Surface Area: 136.68Molecular Species: ACIDHBA: 7HBD: 5
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 5#RO5 Violations (Lipinski): 2
CX Acidic pKa: 4.74CX Basic pKa: CX LogP: 4.59CX LogD: 1.99
Aromatic Rings: Heavy Atoms: 44QED Weighted: 0.27Np Likeness Score: 2.67

References

1. Anderson, Orlagh, Beckett, Joseph, Briggs, Carla C., Natrass, Liam A., Cranston, Charles F., Wilkinson, Elizabeth J., Owen, Jack H., Mir Williams, Rhodri, Loukaidis, Angelos, Bouillon, Marc E., Pritchard, Deiniol, Lahmann, Martina, Baird, Mark S., Denny, Paul W..  (2020)  An investigation of the antileishmanial properties of semi-synthetic saponins,  11  (7): [PMID:33479679] [10.1039/d0md00123f]

Source