(Z)-5-(3-methyl-2-(6-(1-methyl-1H-pyrrolo[2,3-b]pyridin-5-yl)-2-oxo-1,2-dihydropyridin-3-yl)butylidene)oxazolidine-2,4-dione

ID: ALA4758607

PubChem CID: 162657359

Max Phase: Preclinical

Molecular Formula: C24H27N3O5

Molecular Weight: 437.50

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCN1CCOc2ccc(-c3ccc(C(/C=C4\OC(=O)NC4=O)(CC)CC)c(=O)[nH]3)cc21

Standard InChI:  InChI=1S/C24H27N3O5/c1-4-24(5-2,14-20-22(29)26-23(30)32-20)16-8-9-17(25-21(16)28)15-7-10-19-18(13-15)27(6-3)11-12-31-19/h7-10,13-14H,4-6,11-12H2,1-3H3,(H,25,28)(H,26,29,30)/b20-14-

Standard InChI Key:  NGAOJCKLQFPTDI-ZHZULCJRSA-N

Molfile:  

 
     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
   15.2749   -5.1425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6876   -4.4368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8700   -4.4322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4016   -4.8454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4016   -5.6626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1069   -6.0670    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.8122   -5.6626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8122   -4.8454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1069   -4.4326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6945   -6.0722    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.5175   -6.0711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5149   -6.8894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2212   -7.2989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2222   -5.6641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6852   -3.6190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9748   -3.2151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8797   -2.4048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0792   -2.2401    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.6753   -2.9506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2262   -3.5541    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.8632   -3.0414    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.4818   -1.8523    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.9260   -6.0667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9278   -6.8906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6383   -7.2987    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.3515   -6.8874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3497   -6.0635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6346   -5.6509    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.6316   -4.8337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3379   -4.4225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4577   -5.1380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1564   -4.0199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  1  0
  4  9  2  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  4  2  1  0
  5 10  2  0
 11 12  2  0
 12 13  1  0
 13 24  2  0
 23 14  2  0
 14 11  1  0
  7 11  1  0
  2 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 16  1  0
 19 21  2  0
 17 22  2  0
 23 24  1  0
 23 28  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
  1 31  1  0
  3 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4758607

    ---

Associated Targets(Human)

PTGER3 Tclin Prostanoid EP3 receptor (1985 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 437.50Molecular Weight (Monoisotopic): 437.1951AlogP: 3.47#Rotatable Bonds: 6
Polar Surface Area: 100.73Molecular Species: ACIDHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 6.15CX Basic pKa: 1.73CX LogP: 2.60CX LogD: 1.41
Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.67Np Likeness Score: -0.66

References

1. Zhang X,Zhu B,Guo L,Bakaj I,Rankin M,Ho G,Kauffman J,Lee SP,Norquay L,Macielag MJ.  (2021)  Discovery of a Novel Series of Pyridone-Based EP3 Antagonists for the Treatment of Type 2 Diabetes.,  12  (3): [PMID:33738072] [10.1021/acsmedchemlett.0c00667]

Source