NA

ID: ALA4758615

PubChem CID: 162657364

Max Phase: Preclinical

Molecular Formula: C27H33FN8O3

Molecular Weight: 536.61

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CNC1CN(c2cc3n4nc(cc4n2)[C@@H]2CCCCN2C(=O)c2cc(F)ccc2OCC(=O)NCCN3C)C1

Standard InChI:  InChI=1S/C27H33FN8O3/c1-29-18-14-34(15-18)23-13-26-33(2)10-8-30-25(37)16-39-22-7-6-17(28)11-19(22)27(38)35-9-4-3-5-21(35)20-12-24(31-23)36(26)32-20/h6-7,11-13,18,21,29H,3-5,8-10,14-16H2,1-2H3,(H,30,37)/t21-/m0/s1

Standard InChI Key:  DMHNHBINQSBFDO-NRFANRHFSA-N

Molfile:  

 
     RDKit          2D

 40 45  0  0  0  0  0  0  0  0999 V2000
    5.8565   -8.7373    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.5375   -8.9231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6473  -11.7378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6473  -12.5550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3525  -12.9595    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.3525  -11.3251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0578  -11.7378    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0623  -12.5560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8419  -12.8046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3192  -12.1400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8346  -11.4808    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.1341  -12.1350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5454  -12.8423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3590  -12.8397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7675  -12.1315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3562  -11.4243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5364  -11.4252    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.9409  -12.9664    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.1512  -12.7560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9409  -13.5457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7305  -13.7560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3525  -10.5079    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6448  -10.0993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1246  -10.7194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5300  -10.0098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3074  -10.7231    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.3470  -10.0078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7522   -9.2991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3404   -8.5923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5190   -8.5986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1174   -9.3079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3002   -9.3146    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4595   -9.4805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9193  -10.0116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5694   -9.2958    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    7.7179  -12.8398    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.6613   -9.7279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1472   -8.3790    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.2338  -13.9553    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.5255  -13.5477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  3  4  1  0
  3  6  2  0
  4  5  2  0
  5  8  1  0
  7  6  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11  7  1  0
 12 13  1  0
 12 17  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 10 12  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 18  1  0
  4 18  1  0
  6 22  1  0
 22 34  1  0
 22 23  1  0
 17 24  1  0
 24 25  1  0
 24 26  2  0
 25 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 25  1  0
 31 32  1  0
  1 33  1  0
 33 34  1  0
 28 35  1  0
 12 36  1  6
 32 37  1  0
 37  2  1  0
  2  1  1  0
  2 38  2  0
 20 39  1  0
 39 40  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4758615

    ---

Associated Targets(non-human)

F Fusion glycoprotein F0 (67 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 536.61Molecular Weight (Monoisotopic): 536.2660AlogP: 1.59#Rotatable Bonds: 2
Polar Surface Area: 107.34Molecular Species: BASEHBA: 9HBD: 2
#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 13.28CX Basic pKa: 8.75CX LogP: 1.95CX LogD: 0.58
Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.51Np Likeness Score: -1.00

References

1. Yamaguchi-Sasaki T,Kawaguchi T,Okada A,Tokura S,Tanaka-Yamamoto N,Takeuchi T,Ogata Y,Takahashi R,Kurimoto-Tsuruta R,Tamaoki T,Sugaya Y,Abe-Kumasaka T,Arikawa K,Yoshida I,Sugiyama H,Kanuma K,Yoshinaga M.  (2020)  Discovery of a potent dual inhibitor of wild-type and mutant respiratory syncytial virus fusion proteins through the modulation of atropisomer interconversion properties.,  28  (24): [PMID:33190073] [10.1016/j.bmc.2020.115818]

Source