The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-Bromo-4-(2-fluoro-4-nitrophenoxy)-N-(3,4,5-trimethoxyphenyl)pyrimidin-2-amine ID: ALA4758675
PubChem CID: 162658365
Max Phase: Preclinical
Molecular Formula: C19H16BrFN4O6
Molecular Weight: 495.26
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(Nc2ncc(Br)c(Oc3ccc([N+](=O)[O-])cc3F)n2)cc(OC)c1OC
Standard InChI: InChI=1S/C19H16BrFN4O6/c1-28-15-6-10(7-16(29-2)17(15)30-3)23-19-22-9-12(20)18(24-19)31-14-5-4-11(25(26)27)8-13(14)21/h4-9H,1-3H3,(H,22,23,24)
Standard InChI Key: CVOMZGNACQPPDA-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
31.2470 -2.2540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2459 -3.0813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9606 -3.4942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9588 -1.8412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6741 -2.2504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6729 -3.0834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3898 -3.4986 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.3922 -1.8326 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
34.1137 -2.2524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1124 -3.0813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8284 -3.4951 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.5463 -3.0811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5435 -2.2491 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.8269 -1.8390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2612 -3.4926 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.9751 -3.0791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6886 -3.4951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4019 -3.0823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4012 -2.2565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6813 -1.8452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9708 -2.2604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9603 -4.3192 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
30.5341 -1.8459 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.8197 -2.2586 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.5339 -1.0209 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.1146 -1.8420 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.8301 -2.2526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1168 -3.4942 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.1176 -4.3192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6771 -1.0203 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.3895 -0.6043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 10 1 0
9 8 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
12 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
3 22 1 0
23 24 2 0
23 25 1 0
1 23 1 0
19 26 1 0
26 27 1 0
18 28 1 0
28 29 1 0
20 30 1 0
30 31 1 0
M CHG 2 23 1 25 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 495.26Molecular Weight (Monoisotopic): 494.0237AlogP: 4.85#Rotatable Bonds: 8Polar Surface Area: 117.87Molecular Species: NEUTRALHBA: 9HBD: 1#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.99CX Basic pKa: 1.40CX LogP: 4.64CX LogD: 4.64Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.35Np Likeness Score: -1.33
References 1. Sun D,Yang Z,Zhen Y,Yang Y,Chen Y,Yuan Y,Zhang L,Zeng X,Chen L. (2020) Discovery of 5-bromo-4-phenoxy-N-phenylpyrimidin-2-amine derivatives as novel ULK1 inhibitors that block autophagy and induce apoptosis in non-small cell lung cancer., 208 [PMID:32961380 ] [10.1016/j.ejmech.2020.112782 ]