3-((5-cyclopropyl-1H-pyrrol-2-yl)methylene)-7-fluoro-5-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)indolin-2-one

ID: ALA4758698

PubChem CID: 162658671

Max Phase: Preclinical

Molecular Formula: C24H21FN4O2

Molecular Weight: 416.46

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1c(-c2cc(F)c3c(c2)/C(=C/c2ccc(C4CC4)[nH]2)C(=O)N3)cnc2c1NCCO2

Standard InChI:  InChI=1S/C24H21FN4O2/c1-12-18(11-27-24-21(12)26-6-7-31-24)14-8-16-17(23(30)29-22(16)19(25)9-14)10-15-4-5-20(28-15)13-2-3-13/h4-5,8-11,13,26,28H,2-3,6-7H2,1H3,(H,29,30)/b17-10-

Standard InChI Key:  FFWIIJDLELGDJL-YVLHZVERSA-N

Molfile:  

 
     RDKit          2D

 31 36  0  0  0  0  0  0  0  0999 V2000
    6.6581  -19.3778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3745  -18.9645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3717  -18.1340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6562  -17.7248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0861  -19.3751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0861  -20.2012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5112  -19.3696    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.7963  -18.9620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5151  -20.1988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8040  -20.6100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8045  -21.4269    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.5145  -21.8389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2258  -21.4278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2269  -20.6046    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.3728  -20.6159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9433  -18.9649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9400  -18.1406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1549  -17.8890    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6731  -18.5580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1604  -19.2228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8480  -18.5613    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9086  -20.0084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1024  -20.1833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4860  -19.6386    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.7732  -20.0540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9480  -20.8604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7688  -20.9432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0182  -19.7215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6536  -16.8998    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.5283  -19.0541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1958  -19.8091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 16  1  1  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4 17  1  0
  5  6  2  0
  6 10  1  0
  9  7  1  0
  7  8  2  0
  8  5  1  0
  2  5  1  0
  9 10  2  0
  9 14  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
  6 15  1  0
 16 17  2  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 16  1  0
 19 21  2  0
 20 22  2  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 23  2  0
 25 28  1  0
  4 29  1  0
 30 28  1  0
 31 30  1  0
 28 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4758698

    ---

Associated Targets(Human)

MAP4K1 Tchem Mitogen-activated protein kinase kinase kinase kinase 1 (947 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 416.46Molecular Weight (Monoisotopic): 416.1649AlogP: 4.70#Rotatable Bonds: 3
Polar Surface Area: 79.04Molecular Species: NEUTRALHBA: 4HBD: 3
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 9.60CX Basic pKa: 3.47CX LogP: 3.71CX LogD: 3.71
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.54Np Likeness Score: -0.12

References

1. Sabnis RW..  (2021)  Novel Substituted Exomethylene-oxindoles as HPK1 Inhibitors.,  12  (5.0): [PMID:34055207] [10.1021/acsmedchemlett.1c00172]

Source