N-(2-(difluoromethoxy)benzyl)-N-(oxazol-2-ylmethyl)-5-(pyrrolidine-1-carbonyl)-1H-pyrrole-3-carboxamide

ID: ALA4758712

PubChem CID: 162658751

Max Phase: Preclinical

Molecular Formula: C22H22F2N4O4

Molecular Weight: 444.44

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(c1c[nH]c(C(=O)N2CCCC2)c1)N(Cc1ncco1)Cc1ccccc1OC(F)F

Standard InChI:  InChI=1S/C22H22F2N4O4/c23-22(24)32-18-6-2-1-5-15(18)13-28(14-19-25-7-10-31-19)20(29)16-11-17(26-12-16)21(30)27-8-3-4-9-27/h1-2,5-7,10-12,22,26H,3-4,8-9,13-14H2

Standard InChI Key:  QYDKOIRQXZXKTQ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
   26.3360   -5.2598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9932   -5.7454    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.6594   -5.2719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4127   -4.4902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5964   -4.4865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5565   -5.5050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9543   -4.9525    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.0479   -4.1374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3045   -3.7980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7520   -4.4002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1540   -5.1117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3791   -6.3027    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.8974   -3.8322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7122   -3.9269    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.1963   -3.2729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8726   -2.5222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5706   -3.0873    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.0372   -4.6767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8490   -4.7701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1698   -5.5194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9808   -5.6132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4686   -4.9564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1395   -4.2038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3294   -4.1137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6813   -6.1746    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.0045   -6.9252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5160   -7.5803    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   30.8161   -7.0206    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   29.2916   -1.8236    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.7517   -1.2097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0009   -1.5334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0770   -2.3474    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  1  2  0
  1  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11  7  1  0
  6 12  2  0
  4 13  1  0
 13 14  1  0
 13 17  2  0
 14 15  1  0
 15 16  1  0
 14 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 20 25  1  0
 25 26  1  0
 26 27  1  0
 26 28  1  0
 16 29  1  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 16  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4758712

    ---

Associated Targets(Human)

TAB1 Tchem TAK1/TAB1 (257 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 444.44Molecular Weight (Monoisotopic): 444.1609AlogP: 3.68#Rotatable Bonds: 8
Polar Surface Area: 91.67Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.15CX Basic pKa: CX LogP: 2.21CX LogD: 2.21
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.57Np Likeness Score: -1.79

References

1. Veerman JJN,Bruseker YB,Damen E,Heijne EH,van Bruggen W,Hekking KFW,Winkel R,Hupp CD,Keefe AD,Liu J,Thomson HA,Zhang Y,Cuozzo JW,McRiner AJ,Mulvihill MJ,van Rijnsbergen P,Zech B,Renzetti LM,Babiss L,Müller G.  (2021)  Discovery of 2,4-1H-Imidazole Carboxamides as Potent and Selective TAK1 Inhibitors.,  12  (4.0): [PMID:33859795] [10.1021/acsmedchemlett.0c00547]

Source