(R)-2-((S)-2-acetamido-3-(benzyloxy)propanamido)-N-((R)-1-(hydroxyamino)-1-oxo-3-p-tolylpropan-2-yl)-4-phenylbutanamide

ID: ALA4758924

PubChem CID: 162658760

Max Phase: Preclinical

Molecular Formula: C32H38N4O6

Molecular Weight: 574.68

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)N[C@@H](COCc1ccccc1)C(=O)N[C@H](CCc1ccccc1)C(=O)N[C@H](Cc1ccc(C)cc1)C(=O)NO

Standard InChI:  InChI=1S/C32H38N4O6/c1-22-13-15-25(16-14-22)19-28(32(40)36-41)35-30(38)27(18-17-24-9-5-3-6-10-24)34-31(39)29(33-23(2)37)21-42-20-26-11-7-4-8-12-26/h3-16,27-29,41H,17-21H2,1-2H3,(H,33,37)(H,34,39)(H,35,38)(H,36,40)/t27-,28-,29+/m1/s1

Standard InChI Key:  DZJOISUAVMIXBZ-NLDZOOGBSA-N

Molfile:  

 
     RDKit          2D

 42 44  0  0  0  0  0  0  0  0999 V2000
   32.2836  -17.3793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9980  -16.9668    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.5691  -16.9668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2836  -18.2043    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.7125  -17.3793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4270  -16.9668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1414  -17.3793    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.4270  -16.1418    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.8559  -16.9668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5704  -17.3793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8559  -16.1418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5704  -18.2043    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.2848  -16.9668    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.9993  -17.3793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.7138  -16.9668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9993  -18.2043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.7138  -18.6168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4283  -17.3793    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.1428  -16.9668    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.7138  -16.1418    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.7099  -19.4428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4236  -19.8553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.1391  -19.4427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.1364  -18.6135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4222  -18.2047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7125  -18.2043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4270  -18.6168    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.4270  -19.4417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1414  -19.8542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1391  -20.6804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8528  -21.0928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5682  -20.6803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5655  -19.8510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8514  -19.4422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5704  -15.7293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5704  -14.9043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2869  -14.4931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2872  -13.6688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5722  -13.2554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8553  -13.6724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8585  -14.4953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.8540  -19.8542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  1  0
  1  4  2  0
  2  5  1  0
  5  6  1  0
  6  7  1  0
  6  8  2  0
  7  9  1  0
  9 10  1  0
  9 11  1  6
 10 12  2  0
 10 13  1  0
 13 14  1  0
 14 15  1  0
 14 16  1  1
 16 17  1  0
 15 18  1  0
 18 19  1  0
 15 20  2  0
 17 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 17  1  0
  5 26  1  6
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 29  1  0
 11 35  1  0
 35 36  1  0
 36 37  2  0
 37 38  1  0
 38 39  2  0
 39 40  1  0
 40 41  2  0
 41 36  1  0
 23 42  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4758924

    ---

Associated Targets(Human)

MMP12 Tchem Matrix metalloproteinase 12 (1130 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 574.68Molecular Weight (Monoisotopic): 574.2791AlogP: 2.37#Rotatable Bonds: 15
Polar Surface Area: 145.86Molecular Species: NEUTRALHBA: 6HBD: 5
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 5#RO5 Violations (Lipinski): 1
CX Acidic pKa: 8.72CX Basic pKa: CX LogP: 2.95CX LogD: 2.93
Aromatic Rings: 3Heavy Atoms: 42QED Weighted: 0.14Np Likeness Score: -0.12

References

1. Baggio C,Velazquez JV,Fragai M,Nordgren TM,Pellecchia M.  (2020)  Therapeutic Targeting of MMP-12 for the Treatment of Chronic Obstructive Pulmonary Disease.,  63  (21): [PMID:33107733] [10.1021/acs.jmedchem.0c01285]

Source