The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-2-([1,1'-biphenyl]-3-ylsulfonamido)-N-((1R,2R)-2-(benzyloxy)-1-cyanopropyl)-3-(3-chlorophenyl)propanamide ID: ALA4758951
PubChem CID: 162658922
Max Phase: Preclinical
Molecular Formula: C32H30ClN3O4S
Molecular Weight: 588.13
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C[C@@H](OCc1ccccc1)[C@@H](C#N)NC(=O)[C@H](Cc1cccc(Cl)c1)NS(=O)(=O)c1cccc(-c2ccccc2)c1
Standard InChI: InChI=1S/C32H30ClN3O4S/c1-23(40-22-24-10-4-2-5-11-24)31(21-34)35-32(37)30(19-25-12-8-16-28(33)18-25)36-41(38,39)29-17-9-15-27(20-29)26-13-6-3-7-14-26/h2-18,20,23,30-31,36H,19,22H2,1H3,(H,35,37)/t23-,30+,31-/m1/s1
Standard InChI Key: PWVVGLGMUWKXFN-YYSPBGNDSA-N
Molfile:
RDKit 2D
41 44 0 0 0 0 0 0 0 0999 V2000
14.6847 -4.4161 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.0974 -5.1260 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
15.5058 -4.4136 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.8073 -5.5346 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.5191 -5.1219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2268 -5.5346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2268 -6.3559 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.9387 -5.1219 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.6471 -5.5292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6486 -6.3464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3571 -6.7537 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.3586 -7.5709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0670 -7.9782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0653 -8.7962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7730 -9.2034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4809 -8.7935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4768 -7.9721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7686 -7.5685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3919 -5.5372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6862 -5.1281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9798 -5.5373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9808 -6.3554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6942 -6.7625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3978 -6.3509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5202 -4.3047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2284 -3.8970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9337 -4.3101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6414 -3.9031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6429 -3.0850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9307 -2.6757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2259 -3.0851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9289 -1.8585 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
19.3541 -5.1193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9417 -6.7563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0588 -4.7088 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.6996 -7.5771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9924 -7.9889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9965 -8.8053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7069 -9.2109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4147 -8.7941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4072 -7.9791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
5 6 1 0
6 7 2 0
6 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
4 2 1 0
2 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
5 25 1 1
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
30 32 1 0
9 33 1 6
10 34 1 6
33 35 3 0
36 37 2 0
37 38 1 0
38 39 2 0
39 40 1 0
40 41 2 0
41 36 1 0
23 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 588.13Molecular Weight (Monoisotopic): 587.1646AlogP: 5.51#Rotatable Bonds: 12Polar Surface Area: 108.29Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 10.03CX Basic pKa: ┄CX LogP: 6.02CX LogD: 6.02Aromatic Rings: 4Heavy Atoms: 41QED Weighted: 0.23Np Likeness Score: -0.87
References 1. Cianni L,Rocho FDR,Bonatto V,Martins FCP,Lameira J,Leitão A,Montanari CA,Shamim A. (2021) Design, synthesis and stepwise optimization of nitrile-based inhibitors of cathepsins B and L., 29 [PMID:33254069 ] [10.1016/j.bmc.2020.115827 ]