The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-2-benzyl-5-((S)-benzyloxy(phenyl)methyl)-2,3,4,5-tetrahydro-1H-benzo[c]azepine ID: ALA4759075
PubChem CID: 162658838
Max Phase: Preclinical
Molecular Formula: C31H31NO
Molecular Weight: 433.60
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: c1ccc(CO[C@H](c2ccccc2)[C@H]2CCN(Cc3ccccc3)Cc3ccccc32)cc1
Standard InChI: InChI=1S/C31H31NO/c1-4-12-25(13-5-1)22-32-21-20-30(29-19-11-10-18-28(29)23-32)31(27-16-8-3-9-17-27)33-24-26-14-6-2-7-15-26/h1-19,30-31H,20-24H2/t30-,31+/m0/s1
Standard InChI Key: BJFCASHCIKHCPX-IOWSJCHKSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
12.7157 -9.0966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4607 -8.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2027 -9.1164 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.5227 -9.9013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3811 -9.9211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8586 -10.5587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0334 -10.5525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6172 -11.2629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0250 -11.9800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8534 -11.9822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2658 -11.2712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8523 -8.6068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7358 -7.7895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7161 -10.0772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1605 -9.4667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4162 -8.6824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8612 -8.0722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0537 -8.2478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8041 -9.0393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3606 -9.6462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3876 -7.2821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2717 -6.4655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5050 -6.1570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8536 -6.6712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9730 -7.4860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4653 -10.8637 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.0210 -11.4744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7701 -12.2608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9642 -12.4346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7131 -13.2203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2692 -13.8318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0794 -13.6523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3266 -12.8668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1044 -10.6117 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
1 4 1 0
3 5 1 0
4 7 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 6 1 0
3 12 1 0
12 13 1 0
4 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
13 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 13 1 0
14 26 1 6
26 27 1 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
4 34 1 6
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 433.60Molecular Weight (Monoisotopic): 433.2406AlogP: 7.13#Rotatable Bonds: 7Polar Surface Area: 12.47Molecular Species: BASEHBA: 2HBD: ┄#RO5 Violations: 1HBA (Lipinski): 2HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 8.94CX LogP: 7.20CX LogD: 5.66Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.31Np Likeness Score: -0.43
References 1. Ye N,Qin W,Tian S,Xu Q,Wold EA,Zhou J,Zhen XC. (2020) Small Molecules Selectively Targeting Sigma-1 Receptor for the Treatment of Neurological Diseases., 63 (24.0): [PMID:33111525 ] [10.1021/acs.jmedchem.0c01192 ]