(S)-2-benzyl-5-((S)-benzyloxy(phenyl)methyl)-2,3,4,5-tetrahydro-1H-benzo[c]azepine

ID: ALA4759075

PubChem CID: 162658838

Max Phase: Preclinical

Molecular Formula: C31H31NO

Molecular Weight: 433.60

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  c1ccc(CO[C@H](c2ccccc2)[C@H]2CCN(Cc3ccccc3)Cc3ccccc32)cc1

Standard InChI:  InChI=1S/C31H31NO/c1-4-12-25(13-5-1)22-32-21-20-30(29-19-11-10-18-28(29)23-32)31(27-16-8-3-9-17-27)33-24-26-14-6-2-7-15-26/h1-19,30-31H,20-24H2/t30-,31+/m0/s1

Standard InChI Key:  BJFCASHCIKHCPX-IOWSJCHKSA-N

Molfile:  

 
     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
   12.7157   -9.0966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4607   -8.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2027   -9.1164    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.5227   -9.9013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3811   -9.9211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8586  -10.5587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0334  -10.5525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6172  -11.2629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0250  -11.9800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8534  -11.9822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2658  -11.2712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8523   -8.6068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7358   -7.7895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7161  -10.0772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1605   -9.4667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4162   -8.6824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8612   -8.0722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0537   -8.2478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8041   -9.0393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3606   -9.6462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3876   -7.2821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2717   -6.4655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5050   -6.1570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8536   -6.6712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9730   -7.4860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4653  -10.8637    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.0210  -11.4744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7701  -12.2608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9642  -12.4346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7131  -13.2203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2692  -13.8318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0794  -13.6523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3266  -12.8668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1044  -10.6117    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  1  4  1  0
  3  5  1  0
  4  7  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11  6  1  0
  3 12  1  0
 12 13  1  0
  4 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 13 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 13  1  0
 14 26  1  6
 26 27  1  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 28  1  0
  4 34  1  6
M  END

Alternative Forms

  1. Parent:

    ALA4759075

    ---

Associated Targets(non-human)

SIGMAR1 Sigma-1 receptor (3326 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Tmem97 Sigma intracellular receptor 2 (922 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 433.60Molecular Weight (Monoisotopic): 433.2406AlogP: 7.13#Rotatable Bonds: 7
Polar Surface Area: 12.47Molecular Species: BASEHBA: 2HBD:
#RO5 Violations: 1HBA (Lipinski): 2HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 8.94CX LogP: 7.20CX LogD: 5.66
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.31Np Likeness Score: -0.43

References

1. Ye N,Qin W,Tian S,Xu Q,Wold EA,Zhou J,Zhen XC.  (2020)  Small Molecules Selectively Targeting Sigma-1 Receptor for the Treatment of Neurological Diseases.,  63  (24.0): [PMID:33111525] [10.1021/acs.jmedchem.0c01192]

Source