(4aR,6R,6aR,9S,11S,11bS,12R,14R)-11b-(acetoxymethyl)-6,11-dihydroxy-4,4-dimethyl-8-methylene-7-oxotetradecahydro-6a,9-methanocyclohepta[a]naphthalen-12-yl-2-chlorobenzoate

ID: ALA4759146

PubChem CID: 162658472

Max Phase: Preclinical

Molecular Formula: C29H35ClO7

Molecular Weight: 531.05

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C=C1C(=O)[C@@]23[C@H](O)C[C@@H]4C(C)(C)CCC[C@@]4(COC(C)=O)[C@@H]2[C@@H](O)C[C@H]1[C@H]3OC(=O)c1ccccc1Cl

Standard InChI:  InChI=1S/C29H35ClO7/c1-15-18-12-20(32)23-28(14-36-16(2)31)11-7-10-27(3,4)21(28)13-22(33)29(23,24(15)34)25(18)37-26(35)17-8-5-6-9-19(17)30/h5-6,8-9,18,20-23,25,32-33H,1,7,10-14H2,2-4H3/t18-,20+,21-,22-,23+,25-,28+,29-/m1/s1

Standard InChI Key:  IYBYHZBLMKAWCR-UYRIERQWSA-N

Molfile:  

 
     RDKit          2D

 40 44  0  0  0  0  0  0  0  0999 V2000
   27.8877  -14.0285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4832  -13.3227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0742  -14.0259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1931  -12.0845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6170  -12.0845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1931  -12.9058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9030  -11.6718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3310  -11.6718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4832  -11.6718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3310  -10.8422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9030  -13.3227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9030  -10.8422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6170  -12.9058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7692  -12.9058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6170  -10.4336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7692  -12.0845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1931  -11.2591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9030  -12.4972    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   28.1931  -13.7313    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   30.8263  -11.3788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4094  -12.1423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5130  -10.0456    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   27.4854  -10.8505    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.4854  -10.0333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7777   -9.6247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1931   -9.6247    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.1961  -10.4323    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.8006  -12.8598    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.0388  -12.0802    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.3257  -13.3127    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.4412  -12.7820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0305  -13.4885    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.6373  -11.2786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2560  -12.7830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6587  -13.4914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4726  -13.4927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8817  -12.7871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4708  -12.0787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6582  -12.0808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2471  -14.1974    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  5  7  1  0
  6  4  1  0
  7  4  1  0
  2  6  1  0
  8  5  1  0
  9  4  1  0
 10 15  1  0
 11  6  1  0
 12  7  1  0
 13  5  1  0
 14 16  1  0
 15 12  1  0
 16  9  1  0
  4 17  1  6
  7 18  1  1
  6 19  1  1
 14  2  1  0
 13 11  1  0
 10  8  1  0
 10 20  1  0
  5 21  1  1
 21 20  1  0
 10 22  1  1
 17 23  1  0
 23 24  1  0
 24 25  1  0
 24 26  2  0
 12 27  1  1
 21 28  2  0
  8 29  1  1
 13 30  1  6
 29 31  1  0
 31 32  2  0
 31 34  1  0
 20 33  2  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 38  1  0
 38 39  2  0
 39 34  1  0
 35 40  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4759146

    ---

Associated Targets(Human)

ECa-109 cell line (1254 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
TE-1 (337 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MGC-803 (6426 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MCF7 (126967 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 531.05Molecular Weight (Monoisotopic): 530.2071AlogP: 4.13#Rotatable Bonds: 4
Polar Surface Area: 110.13Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 4.03CX LogD: 4.03
Aromatic Rings: 1Heavy Atoms: 37QED Weighted: 0.44Np Likeness Score: 2.30

References

1. Huo JF,Hu TX,Dong YL,Zhao JZ,Liu XJ,Li LL,Zhang XY,Li YF,Liu HM,Ke Y,Wang C.  (2020)  Synthesis and in vitro and in vivo biological evaluation of novel derivatives of flexicaulin A as antiproliferative agents.,  208  [PMID:32883640] [10.1016/j.ejmech.2020.112789]

Source