The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-benzyl-12-[3-(dimethylamino)propyl]benzo[c][1,6]benzodiazocine-6,11-dione ID: ALA4759148
PubChem CID: 162658473
Max Phase: Preclinical
Molecular Formula: C26H27N3O2
Molecular Weight: 413.52
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)CCCN1C(=O)c2ccccc2C(=O)N(Cc2ccccc2)c2ccccc21
Standard InChI: InChI=1S/C26H27N3O2/c1-27(2)17-10-18-28-23-15-8-9-16-24(23)29(19-20-11-4-3-5-12-20)26(31)22-14-7-6-13-21(22)25(28)30/h3-9,11-16H,10,17-19H2,1-2H3
Standard InChI Key: PQBSNDZWUNKMFB-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
32.2322 -20.9168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2311 -21.7363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9391 -22.1453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9373 -20.5079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0551 -22.2990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2365 -22.3058 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.6528 -21.7318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6460 -20.9132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2200 -20.3295 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.0386 -20.3226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6207 -20.8961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6291 -21.7153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3416 -22.1158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0462 -21.6982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0337 -20.8760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3207 -20.4792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3741 -23.0513 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.8226 -23.0093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0055 -23.0026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3454 -19.5652 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.9010 -19.5771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0899 -19.4772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7751 -18.7228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9649 -18.6227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4719 -19.2755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7950 -20.0308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6044 -20.1273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5911 -23.7070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7740 -23.7003 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.3596 -24.4047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3711 -22.9893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 7 2 0
8 4 2 0
4 1 1 0
12 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
5 17 2 0
6 18 1 0
18 19 1 0
10 20 2 0
9 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
19 28 1 0
28 29 1 0
29 30 1 0
29 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 413.52Molecular Weight (Monoisotopic): 413.2103AlogP: 4.45#Rotatable Bonds: 6Polar Surface Area: 43.86Molecular Species: BASEHBA: 3HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 9.30CX LogP: 3.71CX LogD: 1.82Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.60Np Likeness Score: -0.92
References 1. Bieszczad B,Siwek A,Wilczek M,Trzybiński D,Woźniak K,Satała G,Bojarski AJ,Mieczkowski A. (2020) Synthesis, crystal structure and biological activity of novel analogues of tricyclic drugs., 30 (21.0): [PMID:32798652 ] [10.1016/j.bmcl.2020.127493 ]