The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-((3R,4S)-4-(6-(2,6-dichloro-3,5-dimethoxyphenyl)-8-methyl-7-oxo-7,8-dihydropyrido[2,3-d]pyrimidin-2-ylamino)tetrahydrofuran-3-yl)ethenesulfonamide ID: ALA4759172
PubChem CID: 146489226
Max Phase: Preclinical
Molecular Formula: C22H23Cl2N5O6S
Molecular Weight: 556.43
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=CS(=O)(=O)N[C@H]1COC[C@H]1Nc1ncc2cc(-c3c(Cl)c(OC)cc(OC)c3Cl)c(=O)n(C)c2n1
Standard InChI: InChI=1S/C22H23Cl2N5O6S/c1-5-36(31,32)28-14-10-35-9-13(14)26-22-25-8-11-6-12(21(30)29(2)20(11)27-22)17-18(23)15(33-3)7-16(34-4)19(17)24/h5-8,13-14,28H,1,9-10H2,2-4H3,(H,25,26,27)/t13-,14+/m1/s1
Standard InChI Key: IZXXKUVQQOCKPB-KGLIPLIRSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
17.8379 -13.8180 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.6303 -14.0326 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
18.4200 -13.2390 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.3150 -10.6276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3139 -11.4512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0260 -11.8643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7398 -11.4508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7370 -10.6240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0242 -10.2187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6052 -11.8611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8980 -11.4457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8945 -13.0873 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.6107 -12.6811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1831 -12.6760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1917 -11.8572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4874 -11.4400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7740 -11.8448 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.7694 -12.6668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4743 -13.0761 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.0218 -9.3974 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.7324 -8.9826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4523 -11.8624 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.4536 -12.6837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0258 -12.6856 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
24.6031 -10.2191 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
25.3176 -13.0910 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.8910 -13.9087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0553 -13.0715 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.3457 -12.6592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2635 -11.8403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4609 -11.6620 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.0485 -12.3717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5921 -12.9859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4171 -13.7883 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.4591 -14.8381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6761 -15.0898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
10 11 2 0
10 13 1 0
11 15 1 0
14 12 1 0
12 13 1 0
5 10 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
9 20 1 0
20 21 1 0
7 22 1 0
22 23 1 0
6 24 1 0
4 25 1 0
13 26 2 0
12 27 1 0
18 28 1 0
29 28 1 1
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 29 1 0
33 34 1 1
34 2 1 0
2 35 1 0
35 36 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 556.43Molecular Weight (Monoisotopic): 555.0746AlogP: 2.56#Rotatable Bonds: 8Polar Surface Area: 133.67Molecular Species: NEUTRALHBA: 10HBD: 2#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 9.57CX Basic pKa: 2.66CX LogP: 1.99CX LogD: 1.99Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.43Np Likeness Score: -0.33
References 1. Liu H,Niu D,Tham Sjin RT,Dubrovskiy A,Zhu Z,McDonald JJ,Fahnoe K,Wang Z,Munson M,Scholte A,Barrague M,Fitzgerald M,Liu J,Kothe M,Sun F,Murtie J,Ge J,Rocnik J,Harvey D,Ospina B,Perron K,Zheng G,Shehu E,D'Agostino LA. (2020) Discovery of Selective, Covalent FGFR4 Inhibitors with Antitumor Activity in Models of Hepatocellular Carcinoma., 11 (10): [PMID:33062171 ] [10.1021/acsmedchemlett.9b00601 ]