The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(2-Phenoxyphenyl)-4-(3-guanidinopropoxy)benzamide trifluoroacetate ID: ALA4759180
PubChem CID: 162658597
Max Phase: Preclinical
Molecular Formula: C25H25F3N4O5
Molecular Weight: 404.47
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: NC(N)=NCCCOc1ccc(C(=O)Nc2ccccc2Oc2ccccc2)cc1.O=C(O)C(F)(F)F
Standard InChI: InChI=1S/C23H24N4O3.C2HF3O2/c24-23(25)26-15-6-16-29-18-13-11-17(12-14-18)22(28)27-20-9-4-5-10-21(20)30-19-7-2-1-3-8-19;3-2(4,5)1(6)7/h1-5,7-14H,6,15-16H2,(H,27,28)(H4,24,25,26);(H,6,7)
Standard InChI Key: YWJXVNMIVDKXDQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 38 0 0 0 0 0 0 0 0999 V2000
8.5269 -16.3603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2387 -15.9517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9505 -16.3603 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.2387 -15.1304 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8150 -15.9517 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
8.5269 -17.1817 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
7.8128 -16.7689 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.4123 -12.3982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4112 -13.2177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1192 -13.6267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8289 -13.2172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8260 -12.3946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1174 -11.9893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5372 -13.6247 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.2443 -13.2150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9526 -13.6225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6597 -13.2128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3680 -13.6203 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.0751 -13.2106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7835 -13.6180 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.0738 -12.3934 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.7045 -11.9897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7043 -11.1725 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.9969 -12.3985 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.2891 -11.9901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2925 -11.1723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5855 -10.7639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8769 -11.1728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8798 -11.9942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5873 -12.3988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5906 -13.2160 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8845 -13.6274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1783 -13.2208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4727 -13.6315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4755 -14.4496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1898 -14.8552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8925 -14.4421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 2 0
1 5 1 0
1 6 1 0
1 7 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
11 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
19 21 1 0
8 22 1 0
22 23 2 0
22 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
30 31 1 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 404.47Molecular Weight (Monoisotopic): 404.1848AlogP: 3.77#Rotatable Bonds: 9Polar Surface Area: 111.96Molecular Species: BASEHBA: 4HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 5#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 12.45CX LogP: 3.28CX LogD: 0.87Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.29Np Likeness Score: -0.72
References 1. Cardoso FC,Marliac MA,Geoffroy C,Schmit M,Bispat A,Lewis RJ,Tuck KL,Duggan PJ. (2020) The neuronal calcium ion channel activity of constrained analogues of MONIRO-1., 28 (18): [PMID:32828422 ] [10.1016/j.bmc.2020.115655 ]