(R)-2-((S)-2-acetamido-3-(benzyloxy)propanamido)-N-((R)-1-(hydroxyamino)-1-oxo-3-(4-(trifluoromethyl)phenyl)propan-2-yl)-4-phenylbutanamide

ID: ALA4759199

PubChem CID: 162658773

Max Phase: Preclinical

Molecular Formula: C32H35F3N4O6

Molecular Weight: 628.65

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)N[C@@H](COCc1ccccc1)C(=O)N[C@H](CCc1ccccc1)C(=O)N[C@H](Cc1ccc(C(F)(F)F)cc1)C(=O)NO

Standard InChI:  InChI=1S/C32H35F3N4O6/c1-21(40)36-28(20-45-19-24-10-6-3-7-11-24)30(42)37-26(17-14-22-8-4-2-5-9-22)29(41)38-27(31(43)39-44)18-23-12-15-25(16-13-23)32(33,34)35/h2-13,15-16,26-28,44H,14,17-20H2,1H3,(H,36,40)(H,37,42)(H,38,41)(H,39,43)/t26-,27-,28+/m1/s1

Standard InChI Key:  AERJIAPWRCAHES-FCEKVYKBSA-N

Molfile:  

 
     RDKit          2D

 45 47  0  0  0  0  0  0  0  0999 V2000
   16.9751   -5.4625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6895   -5.0500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.2606   -5.0500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9751   -6.2876    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.4040   -5.4625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1186   -5.0500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8330   -5.4625    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.1186   -4.2250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.5475   -5.0500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2620   -5.4625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5475   -4.2250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2620   -6.2876    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.9764   -5.0500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.6909   -5.4625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4054   -5.0500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6909   -6.2876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4054   -6.7001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1198   -5.4625    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.8343   -5.0500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.4054   -4.2250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.4015   -7.5261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1152   -7.9386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8307   -7.5260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8280   -6.6967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1138   -6.2881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4040   -6.2876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1186   -6.7001    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.1186   -7.5251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8330   -7.9376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8307   -8.7636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5443   -9.1760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2598   -8.7635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2571   -7.9342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5429   -7.5256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2620   -3.8125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2620   -2.9875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9785   -2.5763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9788   -1.7521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2638   -1.3388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5469   -1.7556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5500   -2.5785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5457   -7.9376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5468   -8.7626    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   26.2596   -7.5241    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   26.2544   -8.3458    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  1  0
  1  4  2  0
  2  5  1  0
  5  6  1  0
  6  7  1  0
  6  8  2  0
  7  9  1  0
  9 10  1  0
  9 11  1  6
 10 12  2  0
 10 13  1  0
 13 14  1  0
 14 15  1  0
 14 16  1  1
 16 17  1  0
 15 18  1  0
 18 19  1  0
 15 20  2  0
 17 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 17  1  0
  5 26  1  6
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 29  1  0
 11 35  1  0
 35 36  1  0
 36 37  2  0
 37 38  1  0
 38 39  2  0
 39 40  1  0
 40 41  2  0
 41 36  1  0
 23 42  1  0
 42 43  1  0
 42 44  1  0
 42 45  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4759199

    ---

Associated Targets(Human)

MMP12 Tchem Matrix metalloproteinase 12 (1130 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 628.65Molecular Weight (Monoisotopic): 628.2509AlogP: 3.08#Rotatable Bonds: 15
Polar Surface Area: 145.86Molecular Species: NEUTRALHBA: 6HBD: 5
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 5#RO5 Violations (Lipinski): 1
CX Acidic pKa: 8.72CX Basic pKa: CX LogP: 3.31CX LogD: 3.29
Aromatic Rings: 3Heavy Atoms: 45QED Weighted: 0.13Np Likeness Score: -0.26

References

1. Baggio C,Velazquez JV,Fragai M,Nordgren TM,Pellecchia M.  (2020)  Therapeutic Targeting of MMP-12 for the Treatment of Chronic Obstructive Pulmonary Disease.,  63  (21): [PMID:33107733] [10.1021/acs.jmedchem.0c01285]

Source