The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-N-(2-(2-cyano-4,4-difluoropyrrolidin-1-yl)-2-oxoethyl)-2-(tosylmethyl)thiazole-4-carboxamide ID: ALA4759201
PubChem CID: 155754828
Max Phase: Preclinical
Molecular Formula: C19H18F2N4O4S2
Molecular Weight: 468.51
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(S(=O)(=O)Cc2nc(C(=O)NCC(=O)N3CC(F)(F)C[C@H]3C#N)cs2)cc1
Standard InChI: InChI=1S/C19H18F2N4O4S2/c1-12-2-4-14(5-3-12)31(28,29)10-16-24-15(9-30-16)18(27)23-8-17(26)25-11-19(20,21)6-13(25)7-22/h2-5,9,13H,6,8,10-11H2,1H3,(H,23,27)/t13-/m0/s1
Standard InChI Key: IBTPVUMVMUNDFX-ZDUSSCGKSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
18.9529 -2.8659 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.7819 -2.8634 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
19.3652 -2.1467 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.4961 -3.1276 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
27.1412 -3.8729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9640 -3.8077 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
25.0906 -4.4454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9131 -4.3816 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.4437 -5.0095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2063 -4.6947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3405 -3.6787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2486 -5.8111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0548 -6.6117 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.6241 -3.7650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7345 -5.1896 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.8015 -3.8288 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.3351 -3.1483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5125 -3.2121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6910 -2.4041 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.9751 -2.5867 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.2125 -2.9016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2763 -3.7242 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
22.0783 -3.9175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5095 -2.4697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7616 -3.6873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0355 -4.0757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0126 -4.8996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7160 -5.3323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4440 -4.9350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4633 -4.1123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6946 -6.1569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
5 4 1 0
6 5 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 5 1 0
5 11 1 0
11 8 1 0
9 12 1 1
12 13 3 0
7 14 1 0
7 15 2 0
14 16 1 0
16 17 1 0
17 18 1 0
17 19 2 0
18 20 1 0
20 21 2 0
21 22 1 0
22 23 1 0
23 18 2 0
21 24 1 0
24 2 1 0
2 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
28 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 468.51Molecular Weight (Monoisotopic): 468.0738AlogP: 1.92#Rotatable Bonds: 6Polar Surface Area: 120.23Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.90CX Basic pKa: ┄CX LogP: 1.37CX LogD: 1.37Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.69Np Likeness Score: -1.62
References 1. Jung HJ,Nam EH,Park JY,Ghosh P,Kim IS. (2021) Identification of BR102910 as a selective fibroblast activation protein (FAP) inhibitor., 37 [PMID:33571650 ] [10.1016/j.bmcl.2021.127846 ]