(2R,3R,4S,5R,6R)-N-(1,3-benzothiazol-6-yl)-4-[4-(4-bromo-2,3-difluoro-phenyl)triazol-1-yl]-5-hydroxy-6-(hydroxymethyl)-3-methoxy-N-methyl-tetrahydropyran-2-carboxamide

ID: ALA4759243

PubChem CID: 155201773

Max Phase: Preclinical

Molecular Formula: C24H22BrF2N5O5S

Molecular Weight: 610.44

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CO[C@@H]1[C@@H](n2cc(-c3ccc(Br)c(F)c3F)nn2)[C@@H](O)[C@@H](CO)O[C@H]1C(=O)N(C)c1ccc2ncsc2c1

Standard InChI:  InChI=1S/C24H22BrF2N5O5S/c1-31(11-3-6-14-17(7-11)38-10-28-14)24(35)23-22(36-2)20(21(34)16(9-33)37-23)32-8-15(29-30-32)12-4-5-13(25)19(27)18(12)26/h3-8,10,16,20-23,33-34H,9H2,1-2H3/t16-,20+,21+,22-,23-/m1/s1

Standard InChI Key:  VAHFPFWYMCULAM-HWLDZIHSSA-N

Molfile:  

 
     RDKit          2D

 38 42  0  0  0  0  0  0  0  0999 V2000
   22.7614   -8.4940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7932   -9.3129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5171   -9.6931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4495   -8.0571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1738   -8.4336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2116   -9.2513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0009   -9.4682    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.4512   -8.7844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9399   -8.1451    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   22.0377   -8.1144    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.0047   -7.2979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3471   -8.5513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6235   -8.1717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3802   -9.3678    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.5933   -7.3546    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.8737   -6.9749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1806   -7.4084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2117   -8.2260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9360   -8.6100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9687   -9.4265    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.6922   -9.8065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8437   -6.1583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5360   -5.7240    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.4584   -7.0260    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.5196   -8.6605    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.7602   -8.3603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2363   -8.9874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6709   -9.6795    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.4633   -9.4800    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.4210   -8.9321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0651   -8.1966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2505   -8.1410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7942   -8.8200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1582   -9.5563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9716   -9.6083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8911   -7.4071    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   16.5225   -7.5194    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   13.9788   -8.7658    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  1  0
  1 10  1  0
 10 11  1  0
 10 12  1  0
 13 12  1  1
 12 14  2  0
 13 15  1  0
 13 19  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  6
 20 21  1  0
 16 22  1  1
 22 23  1  0
 17 24  1  1
 18 25  1  1
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 25  1  0
 27 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 30  1  0
 32 36  1  0
 31 37  1  0
 33 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4759243

    ---

Associated Targets(Human)

LGALS3 Tchem Galectin-3 (545 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 610.44Molecular Weight (Monoisotopic): 609.0493AlogP: 2.94#Rotatable Bonds: 6
Polar Surface Area: 122.83Molecular Species: NEUTRALHBA: 10HBD: 2
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.72CX Basic pKa: 2.29CX LogP: 2.83CX LogD: 2.83
Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.32Np Likeness Score: -0.55

References

1. Sabnis RW..  (2021)  Novel Galectin-3 Inhibitors for Treating Fibrosis.,  12  (2): [PMID:33603959] [10.1021/acsmedchemlett.0c00671]

Source