The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-(5-(dimethylamino)naphthalene-1-sulfonamido)-N-hydroxyhexanamide ID: ALA4759256
PubChem CID: 44124386
Max Phase: Preclinical
Molecular Formula: C18H25N3O4S
Molecular Weight: 379.48
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)c1cccc2c(S(=O)(=O)NCCCCCC(=O)NO)cccc12
Standard InChI: InChI=1S/C18H25N3O4S/c1-21(2)16-10-6-9-15-14(16)8-7-11-17(15)26(24,25)19-13-5-3-4-12-18(22)20-23/h6-11,19,23H,3-5,12-13H2,1-2H3,(H,20,22)
Standard InChI Key: IAFMTZMOWYBUMQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
26 27 0 0 0 0 0 0 0 0999 V2000
11.3872 -8.2331 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.9789 -7.5206 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
10.5661 -8.2305 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.8358 -6.2831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2659 -7.1100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2631 -6.2795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5477 -5.8704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5495 -7.5233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8347 -7.1105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1219 -7.5230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1226 -8.3482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8422 -8.7592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5520 -8.3443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4070 -7.1113 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.4062 -6.2863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6930 -7.5244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6948 -7.1078 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.4091 -7.5206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1237 -7.1084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8380 -7.5213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5526 -7.1091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2670 -7.5220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9816 -7.1098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6959 -7.5226 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.4105 -7.1105 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.9820 -6.2848 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 9 2 0
8 5 2 0
5 6 1 0
6 7 2 0
7 4 1 0
8 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
10 14 1 0
14 15 1 0
14 16 1 0
5 2 1 0
2 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
23 26 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 379.48Molecular Weight (Monoisotopic): 379.1566AlogP: 2.25#Rotatable Bonds: 9Polar Surface Area: 98.74Molecular Species: NEUTRALHBA: 5HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.87CX Basic pKa: 4.63CX LogP: 1.98CX LogD: 1.97Aromatic Rings: 2Heavy Atoms: 26QED Weighted: 0.35Np Likeness Score: -1.06