(4aR,6R,6aR,9S,11S,11bS,12R,14R)-11b-(acetoxymethyl)-6,11-dihydroxy-4,4-dimethyl-8-methylene-7-oxotetradecahydro-6a,9-methanocyclohepta[a]naphthalen-12-yl-4-(bromomethyl)benzoate

ID: ALA4759269

PubChem CID: 162657684

Max Phase: Preclinical

Molecular Formula: C30H37BrO7

Molecular Weight: 589.52

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C=C1C(=O)[C@@]23[C@H](O)C[C@@H]4C(C)(C)CCC[C@@]4(COC(C)=O)[C@@H]2[C@@H](O)C[C@H]1[C@H]3OC(=O)c1ccc(CBr)cc1

Standard InChI:  InChI=1S/C30H37BrO7/c1-16-20-12-21(33)24-29(15-37-17(2)32)11-5-10-28(3,4)22(29)13-23(34)30(24,25(16)35)26(20)38-27(36)19-8-6-18(14-31)7-9-19/h6-9,20-24,26,33-34H,1,5,10-15H2,2-4H3/t20-,21+,22-,23-,24+,26-,29+,30-/m1/s1

Standard InChI Key:  IOBVWWVMNKZITM-MNKYEVJKSA-N

Molfile:  

 
     RDKit          2D

 41 45  0  0  0  0  0  0  0  0999 V2000
   39.7204  -22.1591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.3160  -21.4533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.9070  -22.1565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.0259  -20.2152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.4498  -20.2152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.0259  -21.0365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.7357  -19.8024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.1638  -19.8024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.3160  -19.8024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.1638  -18.9729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.7357  -21.4533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.7357  -18.9729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.4498  -21.0365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6020  -21.0365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.4498  -18.5643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6020  -20.2152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.0259  -19.3897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.7357  -20.6279    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   40.0259  -21.8619    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   42.6590  -19.5094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.2422  -20.2729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.3458  -18.1762    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   39.3182  -18.9811    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.3182  -18.1639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6104  -17.7553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.0259  -17.7553    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.0288  -18.5629    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   42.6334  -20.9904    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   42.8716  -20.2109    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   42.1585  -21.4434    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   43.2740  -20.9127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.8633  -21.6192    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   43.4701  -19.4093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.0887  -20.9137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.4914  -21.6220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.3054  -21.6233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.7145  -20.9177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.3036  -20.2093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.4910  -20.2115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.5316  -20.9177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.9403  -21.6253    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  5  7  1  0
  6  4  1  0
  7  4  1  0
  2  6  1  0
  8  5  1  0
  9  4  1  0
 10 15  1  0
 11  6  1  0
 12  7  1  0
 13  5  1  0
 14 16  1  0
 15 12  1  0
 16  9  1  0
  4 17  1  6
  7 18  1  1
  6 19  1  1
 14  2  1  0
 13 11  1  0
 10  8  1  0
 10 20  1  0
  5 21  1  1
 21 20  1  0
 10 22  1  1
 17 23  1  0
 23 24  1  0
 24 25  1  0
 24 26  2  0
 12 27  1  1
 21 28  2  0
  8 29  1  1
 13 30  1  6
 29 31  1  0
 31 32  2  0
 31 34  1  0
 20 33  2  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 38  1  0
 38 39  2  0
 39 34  1  0
 37 40  1  0
 40 41  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4759269

    ---

Associated Targets(Human)

ECa-109 cell line (1254 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
TE-1 (337 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MGC-803 (6426 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MCF7 (126967 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 589.52Molecular Weight (Monoisotopic): 588.1723AlogP: 4.37#Rotatable Bonds: 5
Polar Surface Area: 110.13Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 4.20CX LogD: 4.20
Aromatic Rings: 1Heavy Atoms: 38QED Weighted: 0.30Np Likeness Score: 2.51

References

1. Huo JF,Hu TX,Dong YL,Zhao JZ,Liu XJ,Li LL,Zhang XY,Li YF,Liu HM,Ke Y,Wang C.  (2020)  Synthesis and in vitro and in vivo biological evaluation of novel derivatives of flexicaulin A as antiproliferative agents.,  208  [PMID:32883640] [10.1016/j.ejmech.2020.112789]

Source