The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-(4-(4-methoxyphenyl)piperazin-1-yl)(1-l-phenylethyl)-1H-imidazol-5-Amethanone ID: ALA4759282
PubChem CID: 162657867
Max Phase: Preclinical
Molecular Formula: C23H26N4O2
Molecular Weight: 390.49
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(N2CCN(C(=O)c3cncn3[C@H](C)c3ccccc3)CC2)cc1
Standard InChI: InChI=1S/C23H26N4O2/c1-18(19-6-4-3-5-7-19)27-17-24-16-22(27)23(28)26-14-12-25(13-15-26)20-8-10-21(29-2)11-9-20/h3-11,16-18H,12-15H2,1-2H3/t18-/m1/s1
Standard InChI Key: RROFHJSZMIIZHL-GOSISDBHSA-N
Molfile:
RDKit 2D
29 32 0 0 0 0 0 0 0 0999 V2000
30.2917 -13.5146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6678 -14.0580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8292 -14.8686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6139 -15.1368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2375 -14.5841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0730 -13.7756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0213 -14.8443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1858 -15.6537 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.6243 -16.2600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0341 -16.9802 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.8443 -16.8141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9342 -15.9920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6517 -15.5797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6406 -14.2992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6550 -14.7537 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.3623 -15.9928 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.3576 -16.8122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0640 -17.2252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7794 -16.8198 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.7839 -15.9970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0729 -15.5795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4859 -17.2349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4790 -18.0579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1872 -18.4736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9027 -18.0674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9056 -17.2413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1969 -16.8293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.6123 -18.4822 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.6077 -19.3041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 1 0
9 10 2 0
8 9 1 0
10 11 1 0
11 12 2 0
12 8 1 0
12 13 1 0
7 14 1 1
13 15 2 0
13 16 1 0
16 17 1 0
16 21 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
19 22 1 0
25 28 1 0
28 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 390.49Molecular Weight (Monoisotopic): 390.2056AlogP: 3.46#Rotatable Bonds: 5Polar Surface Area: 50.60Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 4.83CX LogP: 3.02CX LogD: 3.02Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.67Np Likeness Score: -1.25
References 1. Zhao S,Li X,Wang L,Peng W,Ye W,Li W,Wang YD,Chen WD. (2021) Design, synthesis and evaluation of 1-benzyl-1H-imidazole-5-carboxamide derivatives as potent TGR5 agonists., 32 [PMID:33440321 ] [10.1016/j.bmc.2020.115972 ]