(R)-(4-(4-methoxyphenyl)piperazin-1-yl)(1-l-phenylethyl)-1H-imidazol-5-Amethanone

ID: ALA4759282

PubChem CID: 162657867

Max Phase: Preclinical

Molecular Formula: C23H26N4O2

Molecular Weight: 390.49

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(N2CCN(C(=O)c3cncn3[C@H](C)c3ccccc3)CC2)cc1

Standard InChI:  InChI=1S/C23H26N4O2/c1-18(19-6-4-3-5-7-19)27-17-24-16-22(27)23(28)26-14-12-25(13-15-26)20-8-10-21(29-2)11-9-20/h3-11,16-18H,12-15H2,1-2H3/t18-/m1/s1

Standard InChI Key:  RROFHJSZMIIZHL-GOSISDBHSA-N

Molfile:  

 
     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
   30.2917  -13.5146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6678  -14.0580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8292  -14.8686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6139  -15.1368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2375  -14.5841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0730  -13.7756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0213  -14.8443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1858  -15.6537    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.6243  -16.2600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0341  -16.9802    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.8443  -16.8141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9342  -15.9920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6517  -15.5797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6406  -14.2992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6550  -14.7537    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.3623  -15.9928    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.3576  -16.8122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0640  -17.2252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7794  -16.8198    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.7839  -15.9970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0729  -15.5795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4859  -17.2349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4790  -18.0579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1872  -18.4736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9027  -18.0674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9056  -17.2413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1969  -16.8293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6123  -18.4822    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.6077  -19.3041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  9 10  2  0
  8  9  1  0
 10 11  1  0
 11 12  2  0
 12  8  1  0
 12 13  1  0
  7 14  1  1
 13 15  2  0
 13 16  1  0
 16 17  1  0
 16 21  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 19 22  1  0
 25 28  1  0
 28 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4759282

    ---

Associated Targets(Human)

GPBAR1 Tchem G-protein coupled bile acid receptor 1 (1723 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 390.49Molecular Weight (Monoisotopic): 390.2056AlogP: 3.46#Rotatable Bonds: 5
Polar Surface Area: 50.60Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 4.83CX LogP: 3.02CX LogD: 3.02
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.67Np Likeness Score: -1.25

References

1. Zhao S,Li X,Wang L,Peng W,Ye W,Li W,Wang YD,Chen WD.  (2021)  Design, synthesis and evaluation of 1-benzyl-1H-imidazole-5-carboxamide derivatives as potent TGR5 agonists.,  32  [PMID:33440321] [10.1016/j.bmc.2020.115972]

Source