The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-amino-6-(2-fluoroethoxy)-2-(furan-2-yl)-N-((3-methylpyridin-2-yl)methyl)pyrimidine-5-carboxamide ID: ALA4759461
PubChem CID: 142609098
Max Phase: Preclinical
Molecular Formula: C18H18FN5O3
Molecular Weight: 371.37
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cccnc1CNC(=O)c1c(N)nc(-c2ccco2)nc1OCCF
Standard InChI: InChI=1S/C18H18FN5O3/c1-11-4-2-7-21-12(11)10-22-17(25)14-15(20)23-16(13-5-3-8-26-13)24-18(14)27-9-6-19/h2-5,7-8H,6,9-10H2,1H3,(H,22,25)(H2,20,23,24)
Standard InChI Key: RALRYJLRCWEZLS-UHFFFAOYSA-N
Molfile:
RDKit 2D
27 29 0 0 0 0 0 0 0 0999 V2000
4.8068 -17.3789 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.8057 -18.2063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5205 -18.6191 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.2370 -18.2058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2340 -17.3753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5187 -16.9662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0895 -18.6196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3360 -18.2836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7835 -18.8962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1955 -19.6110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0025 -19.4400 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.9520 -18.6172 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.9470 -16.9601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6629 -17.3699 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.9438 -16.1351 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.3759 -16.9547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0920 -17.3646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0919 -18.1884 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.8070 -18.5981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5210 -18.1829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5152 -17.3537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7994 -16.9476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7927 -16.1226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5162 -16.1412 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8006 -15.7308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0873 -16.1454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3716 -15.7351 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 7 1 0
2 7 1 0
4 12 1 0
5 13 1 0
13 14 1 0
13 15 2 0
14 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
22 23 1 0
6 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 371.37Molecular Weight (Monoisotopic): 371.1394AlogP: 2.30#Rotatable Bonds: 7Polar Surface Area: 116.16Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.46CX Basic pKa: 4.69CX LogP: 2.73CX LogD: 2.73Aromatic Rings: 3Heavy Atoms: 27QED Weighted: 0.65Np Likeness Score: -1.63