4-amino-6-(2-fluoroethoxy)-2-(furan-2-yl)-N-((3-methylpyridin-2-yl)methyl)pyrimidine-5-carboxamide

ID: ALA4759461

PubChem CID: 142609098

Max Phase: Preclinical

Molecular Formula: C18H18FN5O3

Molecular Weight: 371.37

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1cccnc1CNC(=O)c1c(N)nc(-c2ccco2)nc1OCCF

Standard InChI:  InChI=1S/C18H18FN5O3/c1-11-4-2-7-21-12(11)10-22-17(25)14-15(20)23-16(13-5-3-8-26-13)24-18(14)27-9-6-19/h2-5,7-8H,6,9-10H2,1H3,(H,22,25)(H2,20,23,24)

Standard InChI Key:  RALRYJLRCWEZLS-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 27 29  0  0  0  0  0  0  0  0999 V2000
    4.8068  -17.3789    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.8057  -18.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5205  -18.6191    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.2370  -18.2058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2340  -17.3753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5187  -16.9662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0895  -18.6196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3360  -18.2836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7835  -18.8962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1955  -19.6110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0025  -19.4400    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.9520  -18.6172    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.9470  -16.9601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6629  -17.3699    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.9438  -16.1351    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.3759  -16.9547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0920  -17.3646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0919  -18.1884    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.8070  -18.5981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5210  -18.1829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5152  -17.3537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7994  -16.9476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7927  -16.1226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5162  -16.1412    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8006  -15.7308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0873  -16.1454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3716  -15.7351    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11  7  1  0
  2  7  1  0
  4 12  1  0
  5 13  1  0
 13 14  1  0
 13 15  2  0
 14 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 22 23  1  0
  6 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4759461

    ---

Associated Targets(Human)

ADORA2A Tclin Adenosine A2a receptor (16305 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ADORA1 Tclin Adenosine A1 receptor (17603 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ADORA3 Tchem Adenosine A3 receptor (15931 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 371.37Molecular Weight (Monoisotopic): 371.1394AlogP: 2.30#Rotatable Bonds: 7
Polar Surface Area: 116.16Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 12.46CX Basic pKa: 4.69CX LogP: 2.73CX LogD: 2.73
Aromatic Rings: 3Heavy Atoms: 27QED Weighted: 0.65Np Likeness Score: -1.63

References

1. Yu F,Zhu C,Xie Q,Wang Y.  (2020)  Adenosine A Receptor Antagonists for Cancer Immunotherapy.,  63  (21): [PMID:32667814] [10.1021/acs.jmedchem.0c00237]

Source