The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-(naphthalen-2-ylmethylene)-2-oxoindolin-5-yl)-3-(piperidin-1-yl)propanamide ID: ALA4759481
PubChem CID: 162657880
Max Phase: Preclinical
Molecular Formula: C27H27N3O2
Molecular Weight: 425.53
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CCN1CCCCC1)Nc1ccc2c(c1)/C(=C\c1ccc3ccccc3c1)C(=O)N2
Standard InChI: InChI=1S/C27H27N3O2/c31-26(12-15-30-13-4-1-5-14-30)28-22-10-11-25-23(18-22)24(27(32)29-25)17-19-8-9-20-6-2-3-7-21(20)16-19/h2-3,6-11,16-18H,1,4-5,12-15H2,(H,28,31)(H,29,32)/b24-17+
Standard InChI Key: ICXYZSDBCGLXNA-JJIBRWJFSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
5.8758 -20.8425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8746 -21.6620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5827 -22.0710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5809 -20.4336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2895 -20.8389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2898 -21.6575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0684 -21.9102 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.5494 -21.2478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0680 -20.5857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1679 -20.4340 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.4603 -20.8428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4605 -21.6600 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3666 -21.2475 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.3202 -19.8084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7732 -19.2013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0295 -18.4258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4833 -17.8190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9799 -19.3745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7525 -20.4344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0449 -20.8431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3371 -20.4347 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.6295 -20.8435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3369 -19.6175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9217 -20.4351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6291 -19.2091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9215 -19.6179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4320 -18.7710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6865 -17.9902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1381 -17.3815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3350 -17.5523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0833 -18.3373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6335 -18.9427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 5 1 0
1 10 1 0
10 11 1 0
11 12 2 0
8 13 2 0
9 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 28 2 0
27 18 2 0
18 15 1 0
11 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
21 23 1 0
22 24 1 0
23 25 1 0
24 26 1 0
26 25 1 0
27 28 1 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 425.53Molecular Weight (Monoisotopic): 425.2103AlogP: 5.15#Rotatable Bonds: 5Polar Surface Area: 61.44Molecular Species: BASEHBA: 3HBD: 2#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.41CX Basic pKa: 9.26CX LogP: 4.47CX LogD: 2.61Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.56Np Likeness Score: -1.16
References 1. Yao D,Ruhan A,Jiang J,Huang J,Wang J,Han W. (2020) Design, synthesis and biological evaluation of 2-indolinone derivatives as PAK1 inhibitors in MDA-MB-231 cells., 30 (17): [PMID:32738980 ] [10.1016/j.bmcl.2020.127355 ]