N-(3-(naphthalen-2-ylmethylene)-2-oxoindolin-5-yl)-3-(piperidin-1-yl)propanamide

ID: ALA4759481

PubChem CID: 162657880

Max Phase: Preclinical

Molecular Formula: C27H27N3O2

Molecular Weight: 425.53

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(CCN1CCCCC1)Nc1ccc2c(c1)/C(=C\c1ccc3ccccc3c1)C(=O)N2

Standard InChI:  InChI=1S/C27H27N3O2/c31-26(12-15-30-13-4-1-5-14-30)28-22-10-11-25-23(18-22)24(27(32)29-25)17-19-8-9-20-6-2-3-7-21(20)16-19/h2-3,6-11,16-18H,1,4-5,12-15H2,(H,28,31)(H,29,32)/b24-17+

Standard InChI Key:  ICXYZSDBCGLXNA-JJIBRWJFSA-N

Molfile:  

 
     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
    5.8758  -20.8425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8746  -21.6620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5827  -22.0710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5809  -20.4336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2895  -20.8389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2898  -21.6575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0684  -21.9102    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.5494  -21.2478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0680  -20.5857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1679  -20.4340    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.4603  -20.8428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4605  -21.6600    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.3666  -21.2475    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.3202  -19.8084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7732  -19.2013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0295  -18.4258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4833  -17.8190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9799  -19.3745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7525  -20.4344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0449  -20.8431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3371  -20.4347    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.6295  -20.8435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3369  -19.6175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9217  -20.4351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6291  -19.2091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9215  -19.6179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4320  -18.7710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6865  -17.9902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1381  -17.3815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3350  -17.5523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0833  -18.3373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6335  -18.9427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9  5  1  0
  1 10  1  0
 10 11  1  0
 11 12  2  0
  8 13  2  0
  9 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 28  2  0
 27 18  2  0
 18 15  1  0
 11 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 21 23  1  0
 22 24  1  0
 23 25  1  0
 24 26  1  0
 26 25  1  0
 27 28  1  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4759481

    ---

Associated Targets(Human)

PAK1 Tchem Serine/threonine-protein kinase PAK 1 (2601 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 425.53Molecular Weight (Monoisotopic): 425.2103AlogP: 5.15#Rotatable Bonds: 5
Polar Surface Area: 61.44Molecular Species: BASEHBA: 3HBD: 2
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.41CX Basic pKa: 9.26CX LogP: 4.47CX LogD: 2.61
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.56Np Likeness Score: -1.16

References

1. Yao D,Ruhan A,Jiang J,Huang J,Wang J,Han W.  (2020)  Design, synthesis and biological evaluation of 2-indolinone derivatives as PAK1 inhibitors in MDA-MB-231 cells.,  30  (17): [PMID:32738980] [10.1016/j.bmcl.2020.127355]

Source