(Z)-5-(2-ethyl-2-(6-(1-ethyl-5-fluoro-1H-indazol-6-yl)-2-oxo-1,2-dihydropyridin-3-yl)butylidene)oxazolidine-2,4-dione

ID: ALA4759511

PubChem CID: 162658087

Max Phase: Preclinical

Molecular Formula: C23H23FN4O4

Molecular Weight: 438.46

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCn1ncc2cc(F)c(-c3ccc(C(/C=C4\OC(=O)NC4=O)(CC)CC)c(=O)[nH]3)cc21

Standard InChI:  InChI=1S/C23H23FN4O4/c1-4-23(5-2,11-19-21(30)27-22(31)32-19)15-7-8-17(26-20(15)29)14-10-18-13(9-16(14)24)12-25-28(18)6-3/h7-12H,4-6H2,1-3H3,(H,26,29)(H,27,30,31)/b19-11-

Standard InChI Key:  PWLKXLVSDQZKJH-ODLFYWEKSA-N

Molfile:  

 
     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
   14.2307  -19.2164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6434  -18.5106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7722  -18.6629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3574  -18.9192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3574  -19.7364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0627  -20.1409    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.7680  -19.7364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7680  -18.9192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0627  -18.5065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6503  -20.1460    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.4733  -20.1450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4707  -20.9633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1770  -21.3728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1780  -19.7379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6410  -17.6928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9306  -17.2889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8355  -16.4786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0350  -16.3140    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.6311  -17.0244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1820  -17.6280    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.8190  -17.1153    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.4376  -15.9261    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.0297  -18.2877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4135  -19.2118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8860  -20.1363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8836  -20.9645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6706  -21.2228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1594  -20.5541    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.6745  -19.8827    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.9292  -19.1062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7290  -18.9386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7620  -21.3701    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  1  0
  4  9  2  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  4  2  1  0
  5 10  2  0
 11 12  2  0
 12 13  1  0
 13 26  2  0
 25 14  2  0
 14 11  1  0
  7 11  1  0
  2 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 16  1  0
 19 21  2  0
 17 22  2  0
  3 23  1  0
  1 24  1  0
 25 26  1  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 25  1  0
 29 30  1  0
 30 31  1  0
 12 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4759511

    ---

Associated Targets(Human)

PTGER3 Tclin Prostanoid EP3 receptor (1985 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 438.46Molecular Weight (Monoisotopic): 438.1703AlogP: 3.76#Rotatable Bonds: 6
Polar Surface Area: 106.08Molecular Species: ACIDHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 6.15CX Basic pKa: 1.32CX LogP: 2.41CX LogD: 1.22
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.57Np Likeness Score: -0.86

References

1. Zhang X,Zhu B,Guo L,Bakaj I,Rankin M,Ho G,Kauffman J,Lee SP,Norquay L,Macielag MJ.  (2021)  Discovery of a Novel Series of Pyridone-Based EP3 Antagonists for the Treatment of Type 2 Diabetes.,  12  (3): [PMID:33738072] [10.1021/acsmedchemlett.0c00667]

Source