6-fluoro-2-methyl-4-[7-[4-(4-methylpiperazin-1-yl)phenyl]imidazo[1,2-a]pyridin-3-yl]quinoline

ID: ALA4759531

PubChem CID: 162658269

Max Phase: Preclinical

Molecular Formula: C28H26FN5

Molecular Weight: 451.55

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cc(-c2cnc3cc(-c4ccc(N5CCN(C)CC5)cc4)ccn23)c2cc(F)ccc2n1

Standard InChI:  InChI=1S/C28H26FN5/c1-19-15-25(24-17-22(29)5-8-26(24)31-19)27-18-30-28-16-21(9-10-34(27)28)20-3-6-23(7-4-20)33-13-11-32(2)12-14-33/h3-10,15-18H,11-14H2,1-2H3

Standard InChI Key:  DFQZCTKEPHHJJW-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 39  0  0  0  0  0  0  0  0999 V2000
    7.4414   -4.4780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4414   -5.2994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1508   -5.7080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1508   -4.0653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8561   -4.4780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8560   -5.2958    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.6340   -5.5474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1165   -4.8891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6341   -4.2267    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.7308   -4.0736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7297   -3.2512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0175   -2.8406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3059   -3.2555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3109   -4.0810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0237   -4.4838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5923   -2.8458    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.5894   -2.0213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8799   -1.6158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1715   -2.0239    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.1730   -2.8462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8829   -3.2603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4595   -1.6157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6288   -6.3642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9165   -6.7662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9110   -7.5823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6163   -7.9960    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.3307   -6.7730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3279   -7.5841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0278   -7.9903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7309   -7.5865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7298   -6.7724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0294   -6.3698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2005   -7.9860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4369   -6.3626    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  2  0
  2  3  2  0
  3  6  1  0
  5  4  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  2  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  1 10  1  0
 13 16  1  0
 16 17  1  0
 16 21  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 19 22  1  0
  7 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 28  1  0
 27 23  1  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 27  2  0
 25 33  1  0
 31 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4759531

    ---

Associated Targets(Human)

ACVR1 Tchem Activin receptor type-1 (1516 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 451.55Molecular Weight (Monoisotopic): 451.2172AlogP: 5.42#Rotatable Bonds: 3
Polar Surface Area: 36.67Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 7.88CX LogP: 4.36CX LogD: 3.75
Aromatic Rings: 5Heavy Atoms: 34QED Weighted: 0.37Np Likeness Score: -1.42

References

1. Engers DW,Bollinger SR,Felts AS,Vadukoot AK,Williams CH,Blobaum AL,Lindsley CW,Hong CC,Hopkins CR.  (2020)  Discovery, synthesis and characterization of a series of 7-aryl-imidazo[1,2-a]pyridine-3-ylquinolines as activin-like kinase (ALK) inhibitors.,  30  (18): [PMID:32750526] [10.1016/j.bmcl.2020.127418]

Source