The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(pyridin-2-ylmethyl)-tabernaemontanine ID: ALA4759715
PubChem CID: 162658797
Max Phase: Preclinical
Molecular Formula: C27H31N3O3
Molecular Weight: 445.56
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC[C@@H]1CN(C)[C@H]2Cc3c(n(Cc4ccccn4)c4ccccc34)C(=O)C[C@H]1C2C(=O)OC
Standard InChI: InChI=1S/C27H31N3O3/c1-4-17-15-29(2)23-13-21-19-10-5-6-11-22(19)30(16-18-9-7-8-12-28-18)26(21)24(31)14-20(17)25(23)27(32)33-3/h5-12,17,20,23,25H,4,13-16H2,1-3H3/t17-,20-,23+,25?/m1/s1
Standard InChI Key: JEHBKOIRIJWMFO-BIZSKIPPSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
0.5562 -11.1120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5551 -11.9384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2690 -12.3508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2672 -10.6997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9819 -11.1084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9821 -11.9384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7716 -12.1947 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.7732 -10.8534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2631 -11.5216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1025 -10.0954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4180 -10.6750 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0825 -11.4327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5682 -12.0983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3917 -12.0123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7272 -11.2547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2391 -10.5830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6624 -12.1442 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8236 -9.9550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8765 -12.6786 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
6.0055 -8.7190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8015 -8.9322 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7922 -7.9229 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.3842 -8.3496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9318 -10.0109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4228 -9.3017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9246 -9.1851 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
6.5466 -11.1677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0316 -11.8338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0254 -12.9787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4733 -13.5905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6695 -13.4145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1176 -14.0255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3713 -14.8105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1818 -14.9810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7301 -14.3687 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 9 1 0
8 5 1 0
8 9 2 0
8 10 1 0
9 12 1 0
11 24 1 0
24 10 1 0
11 16 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
12 17 2 0
11 18 1 0
14 19 1 6
25 20 1 0
20 21 1 0
20 22 2 0
21 23 1 0
14 25 1 0
25 24 1 0
24 26 1 6
15 27 1 1
27 28 1 0
7 29 1 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 445.56Molecular Weight (Monoisotopic): 445.2365AlogP: 3.96#Rotatable Bonds: 4Polar Surface Area: 64.43Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.57CX LogP: 3.47CX LogD: 3.07Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.57Np Likeness Score: 0.22
References 1. Cardoso DSP,Kincses A,Nové M,Spengler G,Mulhovo S,Aires-de-Sousa J,Dos Santos DJVA,Ferreira MU. (2021) Alkylated monoterpene indole alkaloid derivatives as potent P-glycoprotein inhibitors in resistant cancer cells., 210 [PMID:33189435 ] [10.1016/j.ejmech.2020.112985 ]