N-propyl-tabernaemontanine

ID: ALA4759750

PubChem CID: 162657488

Max Phase: Preclinical

Molecular Formula: C24H32N2O3

Molecular Weight: 396.53

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCn1c2c(c3ccccc31)C[C@H]1C(C(=O)OC)[C@H](CC2=O)[C@H](CC)CN1C

Standard InChI:  InChI=1S/C24H32N2O3/c1-5-11-26-19-10-8-7-9-16(19)18-12-20-22(24(28)29-4)17(13-21(27)23(18)26)15(6-2)14-25(20)3/h7-10,15,17,20,22H,5-6,11-14H2,1-4H3/t15-,17-,20+,22?/m1/s1

Standard InChI Key:  GZRUVQFQFGIENO-LBXXQKFWSA-N

Molfile:  

 
     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
   30.6948   -2.7879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6937   -3.6141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4075   -4.0265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4058   -2.3756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1202   -2.7843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1204   -3.6142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9098   -3.8705    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.9114   -2.5293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4013   -3.1975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2406   -1.7715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5559   -2.3510    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.2205   -3.1085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7061   -3.7740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5294   -3.6881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8649   -2.9305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3769   -2.2590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8005   -3.8199    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.9614   -1.6312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0142   -4.3542    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   36.1432   -0.3953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9390   -0.6085    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.9300    0.4005    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.5216   -0.0259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0698   -1.6869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5606   -0.9779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0626   -0.8613    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   36.6841   -2.8435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1692   -3.5096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1636   -4.6543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6116   -5.2659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8654   -6.0498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  9  1  0
  8  5  1  0
  8  9  2  0
  8 10  1  0
  9 12  1  0
 11 24  1  0
 24 10  1  0
 11 16  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 12 17  2  0
 11 18  1  0
 14 19  1  6
 25 20  1  0
 20 21  1  0
 20 22  2  0
 21 23  1  0
 14 25  1  0
 25 24  1  0
 24 26  1  6
 15 27  1  1
 27 28  1  0
  7 29  1  0
 29 30  1  0
 30 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4759750

    ---

Associated Targets(Human)

COLO 205 (50209 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
COLO 320 (353 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ABCB1 Tchem P-glycoprotein 1 (14716 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

L5178Y (1809 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 396.53Molecular Weight (Monoisotopic): 396.2413AlogP: 3.93#Rotatable Bonds: 4
Polar Surface Area: 51.54Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 7.58CX LogP: 3.76CX LogD: 3.36
Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.74Np Likeness Score: 0.68

References

1. Cardoso DSP,Kincses A,Nové M,Spengler G,Mulhovo S,Aires-de-Sousa J,Dos Santos DJVA,Ferreira MU.  (2021)  Alkylated monoterpene indole alkaloid derivatives as potent P-glycoprotein inhibitors in resistant cancer cells.,  210  [PMID:33189435] [10.1016/j.ejmech.2020.112985]

Source