The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
O-(hydroxy(((R)-1-methoxy-3-((3-(2-((3-phenoxybenzyl)oxy)-phenyl)propanoyl)oxy)propan-2-yl)oxy)phosphoryl)-L-serine) ID: ALA4759762
PubChem CID: 78319666
Max Phase: Preclinical
Molecular Formula: C29H34NO11P
Molecular Weight: 603.56
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC[C@H](COC(=O)CCc1ccccc1OCc1cccc(Oc2ccccc2)c1)OP(=O)(O)OC[C@H](N)C(=O)O
Standard InChI: InChI=1S/C29H34NO11P/c1-36-18-25(41-42(34,35)39-20-26(30)29(32)33)19-38-28(31)15-14-22-9-5-6-13-27(22)37-17-21-8-7-12-24(16-21)40-23-10-3-2-4-11-23/h2-13,16,25-26H,14-15,17-20,30H2,1H3,(H,32,33)(H,34,35)/t25-,26+/m1/s1
Standard InChI Key: PTQYXUFPQFSGGD-FTJBHMTQSA-N
Molfile:
RDKit 2D
42 44 0 0 0 0 0 0 0 0999 V2000
18.8119 -1.3248 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.2246 -2.0347 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
19.6330 -1.3224 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.1032 -2.4474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8109 -2.0389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3955 -2.0389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6878 -2.4474 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.3955 -1.2217 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.1032 -3.2646 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.5187 -2.4474 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.9341 -2.4474 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.6418 -2.0389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3495 -2.4474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3495 -3.2646 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.0572 -3.6732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0572 -4.4904 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.7649 -3.2646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4726 -3.6732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1803 -3.2646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8881 -3.6752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5954 -3.2673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5958 -2.4492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8831 -2.0408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1788 -2.4510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8871 -4.4924 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.5943 -4.9018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3025 -4.4941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0063 -4.9044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7140 -4.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7154 -3.6793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0032 -3.2700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2984 -3.6794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4210 -4.9071 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.1294 -4.4997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8353 -4.9114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5432 -4.5047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5451 -3.6867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8331 -3.2770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1281 -3.6861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6418 -1.2217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3495 -0.8131 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.3495 -0.0041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 5 1 0
4 6 1 0
6 7 1 0
6 8 2 0
4 9 1 6
5 10 1 0
10 2 1 0
2 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 2 0
15 17 1 0
17 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
20 25 1 0
25 26 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
29 33 1 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 34 1 0
12 40 1 6
40 41 1 0
41 42 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 603.56Molecular Weight (Monoisotopic): 603.1869AlogP: 4.09#Rotatable Bonds: 18Polar Surface Area: 173.07Molecular Species: ZWITTERIONHBA: 10HBD: 3#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 1.43CX Basic pKa: 9.38CX LogP: 2.08CX LogD: -0.90Aromatic Rings: 3Heavy Atoms: 42QED Weighted: 0.14Np Likeness Score: 0.13
References 1. Nakamura S,Sayama M,Uwamizu A,Jung S,Ikubo M,Otani Y,Kano K,Omi J,Inoue A,Aoki J,Ohwada T. (2020) Non-naturally Occurring Regio Isomer of Lysophosphatidylserine Exhibits Potent Agonistic Activity toward G Protein-Coupled Receptors., 63 (17): [PMID:32787112 ] [10.1021/acs.jmedchem.0c01126 ]