(R)-3-(1-((3-Chloro-6-(2-(2-hydroxypropan-2-yl)pyrimidin-5-yl)-quinolin-4-yl)amino)ethyl)-4-fluorobenzonitrile

ID: ALA4759848

PubChem CID: 126531179

Max Phase: Preclinical

Molecular Formula: C25H21ClFN5O

Molecular Weight: 461.93

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C[C@@H](Nc1c(Cl)cnc2ccc(-c3cnc(C(C)(C)O)nc3)cc12)c1cc(C#N)ccc1F

Standard InChI:  InChI=1S/C25H21ClFN5O/c1-14(18-8-15(10-28)4-6-21(18)27)32-23-19-9-16(5-7-22(19)29-13-20(23)26)17-11-30-24(31-12-17)25(2,3)33/h4-9,11-14,33H,1-3H3,(H,29,32)/t14-/m1/s1

Standard InChI Key:  MWDITUDLVMBLPB-CQSZACIVSA-N

Molfile:  

 
     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
    9.1996   -8.5062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7951   -7.8005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3862   -8.5036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8602  -10.2937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1546   -9.8832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1616   -9.0660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4560   -8.6514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7434   -9.0581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7406   -9.8753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4462  -10.2858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5658  -10.7083    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.0378   -8.6435    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   14.4588   -7.8343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1672   -7.4317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7532   -7.4238    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.7658   -4.9723    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.4714   -5.3827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4686   -6.1999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7601   -6.6066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0504   -6.1920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3420   -6.5987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6364   -6.1841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6392   -5.3669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3518   -4.9644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0574   -5.3748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5070   -7.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5098   -6.5829    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.2224   -6.1762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9280   -6.5908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9210   -7.4080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2126   -7.8105    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.1742   -6.6145    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    8.0937   -7.3892    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
  5 10  2  0
  4 11  3  0
  8 12  1  0
 13 14  1  6
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 16 25  1  0
 20 25  1  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 26 31  2  0
 26  2  1  0
 22 29  1  0
 18 32  1  0
 15 19  1  0
 13 15  1  0
  7 13  1  0
  2 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4759848

    ---

Associated Targets(Human)

TNF Tclin TNF-alpha (1897 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 461.93Molecular Weight (Monoisotopic): 461.1419AlogP: 5.76#Rotatable Bonds: 5
Polar Surface Area: 94.72Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.36CX Basic pKa: 6.20CX LogP: 4.61CX LogD: 4.59
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.39Np Likeness Score: -1.25

References

1. Xiao HY,Li N,Duan JJ,Jiang B,Lu Z,Ngu K,Tino J,Kopcho LM,Lu H,Chen J,Tebben AJ,Sheriff S,Chang CY,Yanchunas J,Calambur D,Gao M,Shuster DJ,Susulic V,Xie JH,Guarino VR,Wu DR,Gregor KR,Goldstine CB,Hynes J,Macor JE,Salter-Cid L,Burke JR,Shaw PJ,Dhar TGM.  (2020)  Biologic-like In Vivo Efficacy with Small Molecule Inhibitors of TNFα Identified Using Scaffold Hopping and Structure-Based Drug Design Approaches.,  63  (23): [PMID:33261314] [10.1021/acs.jmedchem.0c01732]

Source