The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-((3,5-Dimethylphenyl)(4-(benzyloxy)benzyl)amino)-N,N-diethylacetamide ID: ALA4759879
PubChem CID: 162658804
Max Phase: Preclinical
Molecular Formula: C28H34N2O2
Molecular Weight: 430.59
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCN(CC)C(=O)CN(Cc1ccc(OCc2ccccc2)cc1)c1cc(C)cc(C)c1
Standard InChI: InChI=1S/C28H34N2O2/c1-5-29(6-2)28(31)20-30(26-17-22(3)16-23(4)18-26)19-24-12-14-27(15-13-24)32-21-25-10-8-7-9-11-25/h7-18H,5-6,19-21H2,1-4H3
Standard InChI Key: APPVBAPTWOOGLM-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
25.5461 -20.8012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5450 -21.6249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2572 -22.0338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9709 -21.6244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9681 -20.7976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2554 -20.3882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6834 -22.0319 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.6847 -22.8532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9735 -23.2670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3946 -21.6222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1071 -22.0296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2641 -22.8516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5534 -23.2648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5542 -24.0870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2717 -24.4943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9795 -24.0829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8328 -22.0329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2529 -19.5669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1084 -22.8510 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.8142 -21.6199 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.3972 -23.2648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3985 -24.0861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8167 -23.2626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8180 -24.0839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8436 -24.4976 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.1306 -24.0911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4240 -24.5017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7146 -24.0917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0044 -24.5017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0064 -25.3239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7244 -25.7344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4316 -25.3179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
4 7 1 0
7 8 1 0
8 9 1 0
7 10 1 0
10 11 1 0
9 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 9 1 0
2 17 1 0
6 18 1 0
11 19 1 0
11 20 2 0
19 21 1 0
21 22 1 0
19 23 1 0
23 24 1 0
14 25 1 0
25 26 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 430.59Molecular Weight (Monoisotopic): 430.2620AlogP: 5.76#Rotatable Bonds: 10Polar Surface Area: 32.78Molecular Species: NEUTRALHBA: 3HBD: ┄#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 6.23CX LogD: 6.23Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.41Np Likeness Score: -1.15
References 1. Vo, Sophie V., Banister, Samuel D., Freelander, Isaac, Werry, Eryn L., Reekie, Tristan A., Ittner, Lars M., Kassiou, Michael. (2020) Reversing binding sensitivity to A147T translocator protein, 11 (4): [PMID:33479652 ] [10.1039/c9md00580c ]