N-[4-[(1-bromo-2-naphthyl)oxy]-3-chloro-phenyl]-2,6-dihydroxy-benzamide

ID: ALA4759888

PubChem CID: 162657378

Max Phase: Preclinical

Molecular Formula: C23H15BrClNO4

Molecular Weight: 484.73

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(Nc1ccc(Oc2ccc3ccccc3c2Br)c(Cl)c1)c1c(O)cccc1O

Standard InChI:  InChI=1S/C23H15BrClNO4/c24-22-15-5-2-1-4-13(15)8-10-20(22)30-19-11-9-14(12-16(19)25)26-23(29)21-17(27)6-3-7-18(21)28/h1-12,27-28H,(H,26,29)

Standard InChI Key:  IGAILSSVUFYIIG-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
   17.2520  -28.6231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9603  -28.2082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9556  -27.3819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2464  -26.9785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6737  -28.6181    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.3840  -28.2027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0946  -28.6171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8043  -28.2023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8016  -27.3801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0832  -26.9744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3764  -27.3874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0949  -29.4384    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   21.5113  -26.9678    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.2252  -27.3727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9349  -26.9604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2295  -28.1940    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.6432  -27.3675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3524  -26.9559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3486  -26.1337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6296  -25.7249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9275  -26.1429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5366  -28.2099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5420  -27.3911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8395  -26.9793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1271  -27.3817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1216  -28.2006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8286  -28.6169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2546  -29.4403    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   23.6449  -28.1847    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.2152  -25.7423    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
 22  1  1  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4 23  1  0
  2  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11  6  1  0
  7 12  1  0
  9 13  1  0
 13 14  1  0
 14 15  1  0
 14 16  2  0
 15 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 15  1  0
 22 23  2  0
 22 27  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
  1 28  1  0
 17 29  1  0
 21 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4759888

    ---

Associated Targets(Human)

STK39 Tchem STE20/SPS1-related proline-alanine-rich protein kinase (342 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 484.73Molecular Weight (Monoisotopic): 482.9873AlogP: 6.71#Rotatable Bonds: 4
Polar Surface Area: 78.79Molecular Species: NEUTRALHBA: 4HBD: 3
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 7.77CX Basic pKa: CX LogP: 6.32CX LogD: 6.16
Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.30Np Likeness Score: -0.79

References

1. Fujii S,Kikuchi E,Watanabe Y,Suzuyama H,Ishigami-Yuasa M,Mori T,Isobe K,Uchida S,Kagechika H.  (2020)  Structural development of N-(4-phenoxyphenyl)benzamide derivatives as novel SPAK inhibitors blocking WNK kinase signaling.,  30  (17): [PMID:32738993] [10.1016/j.bmcl.2020.127408]

Source