2[[2-(4-hydroxyanilino)-2-oxo-ethyl]sulfamoy]-N-[(4-nitrophenyl)methylbenzamide

ID: ALA4759895

PubChem CID: 146660777

Max Phase: Preclinical

Molecular Formula: C22H20N4O7S

Molecular Weight: 484.49

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(CNS(=O)(=O)c1ccccc1C(=O)NCc1ccc([N+](=O)[O-])cc1)Nc1ccc(O)cc1

Standard InChI:  InChI=1S/C22H20N4O7S/c27-18-11-7-16(8-12-18)25-21(28)14-24-34(32,33)20-4-2-1-3-19(20)22(29)23-13-15-5-9-17(10-6-15)26(30)31/h1-12,24,27H,13-14H2,(H,23,29)(H,25,28)

Standard InChI Key:  LFWZZQPSOXKGTL-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 36  0  0  0  0  0  0  0  0999 V2000
    7.6577  -14.1285    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.1287  -13.4513    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.3052  -13.3809    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    5.1651  -13.7997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1640  -14.6271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8788  -15.0399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5952  -14.6266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5924  -13.7961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8770  -13.3870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8745  -12.5620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5878  -12.1474    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1589  -12.1516    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.3022  -12.5560    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.0150  -12.1407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7311  -12.5506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7341  -13.3756    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.4439  -12.1354    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.1600  -12.5452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1585  -13.3675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8737  -13.7773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5876  -13.3621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5817  -12.5328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8661  -12.1268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3041  -13.7708    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1564  -11.3266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4407  -10.9163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4402  -10.0942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7253   -9.6839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0111  -10.0986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0162  -10.9279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7316  -11.3344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2948   -9.6892    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.5781  -10.1048    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.2872   -8.8643    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  3  2  2  0
  1  3  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  9 10  1  0
 10 11  2  0
 10 12  1  0
  8  3  1  0
  3 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 15 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 21 24  1  0
 12 25  1  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
 29 32  1  0
 32 33  2  0
 32 34  1  0
M  CHG  2  32   1  34  -1
M  END

Alternative Forms

  1. Parent:

    ALA4759895

    ---

Associated Targets(Human)

Hepatocyte (2737 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 484.49Molecular Weight (Monoisotopic): 484.1053AlogP: 2.15#Rotatable Bonds: 9
Polar Surface Area: 167.74Molecular Species: NEUTRALHBA: 7HBD: 4
#RO5 Violations: HBA (Lipinski): 11HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: 9.13CX Basic pKa: CX LogP: 2.15CX LogD: 2.14
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.20Np Likeness Score: -1.72

References

1. Bazan HA,Bhattacharjee S,Burgos C,Recio J,Abet V,Pahng AR,Jun B,Heap J,Ledet AJ,Gordon WC,Edwards S,Paul D,Alvarez-Builla J,Bazan NG.  (2020)  A novel pipeline of 2-(benzenesulfonamide)-N-(4-hydroxyphenyl) acetamide analgesics that lack hepatotoxicity and retain antipyresis.,  202  [PMID:32629335] [10.1016/j.ejmech.2020.112600]

Source