N-((R)-Carbamoylphenylmethyl)-N-((R)-6-fluoroindan-1-yl)benzamide

ID: ALA4759917

PubChem CID: 118935130

Max Phase: Preclinical

Molecular Formula: C24H21FN2O2

Molecular Weight: 388.44

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  NC(=O)[C@@H](c1ccccc1)N(C(=O)c1ccccc1)[C@@H]1CCc2ccc(F)cc21

Standard InChI:  InChI=1S/C24H21FN2O2/c25-19-13-11-16-12-14-21(20(16)15-19)27(24(29)18-9-5-2-6-10-18)22(23(26)28)17-7-3-1-4-8-17/h1-11,13,15,21-22H,12,14H2,(H2,26,28)/t21-,22-/m1/s1

Standard InChI Key:  HXJLHYYAPUWUMX-FGZHOGPDSA-N

Molfile:  

 
     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
   42.9135  -11.9648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.9124  -12.7885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.6245  -13.2016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.3383  -12.7880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.3355  -11.9612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.6227  -11.5559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.6243  -14.0229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.9124  -14.4313    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   44.3361  -14.4316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.0480  -14.0232    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   44.3359  -15.2530    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   42.2007  -14.0225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.9122  -15.2526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.2003  -15.6652    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   43.4927  -15.8320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.2798  -16.6233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.8554  -17.1984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.6469  -16.9870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.8555  -16.1913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.2784  -15.6197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.1109  -13.2110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.3077  -13.0422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.4496  -14.3626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.9020  -13.7565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.1053  -13.9282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.8551  -14.7055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.4077  -15.3113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.2023  -15.1365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.1605  -16.0902    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  3  1  6
  7  8  1  0
  7  9  1  0
  9 10  1  0
  9 11  2  0
 12  8  1  1
  8 13  1  0
 13 14  2  0
 13 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 12 21  1  0
 21 22  1  0
 22 24  1  0
 23 12  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 27 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4759917

    ---

Associated Targets(Human)

TRPM8 Tclin Transient receptor potential cation channel subfamily M member 8 (1168 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
NR1I2 Tchem Pregnane X receptor (6667 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 388.44Molecular Weight (Monoisotopic): 388.1587AlogP: 4.18#Rotatable Bonds: 5
Polar Surface Area: 63.40Molecular Species: NEUTRALHBA: 2HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 4.29CX LogD: 4.29
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.71Np Likeness Score: -0.97

References

1. Kobayashi JI,Hirasawa H,Fujimori Y,Nakanishi O,Kamada N,Ikeda T,Yamamoto A,Kanbe H.  (2021)  Identification of N-acyl-N-indanyl-α-phenylglycinamides as selective TRPM8 antagonists designed to mitigate the risk of adverse effects.,  30  [PMID:33333445] [10.1016/j.bmc.2020.115903]

Source