The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-((1S)-1-{[((1S)-3-Methoxy-2-oxo-1-{[(3S)-2-oxopyrrolidin-3-yl]-methyl}propyl)amino]carbonyl}-3,3-dimethylbutyl)-1H-indole-2-carboxamide ID: ALA4759976
PubChem CID: 154702365
Max Phase: Preclinical
Molecular Formula: C25H34N4O5
Molecular Weight: 470.57
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COCC(=O)[C@H](C[C@@H]1CCNC1=O)NC(=O)[C@H](CC(C)(C)C)NC(=O)c1cc2ccccc2[nH]1
Standard InChI: InChI=1S/C25H34N4O5/c1-25(2,3)13-20(29-23(32)19-11-15-7-5-6-8-17(15)27-19)24(33)28-18(21(30)14-34-4)12-16-9-10-26-22(16)31/h5-8,11,16,18,20,27H,9-10,12-14H2,1-4H3,(H,26,31)(H,28,33)(H,29,32)/t16-,18-,20-/m0/s1
Standard InChI Key: IULLQBINVRGFGJ-QRFRQXIXSA-N
Molfile:
RDKit 2D
35 37 0 0 0 0 0 0 0 0999 V2000
18.9882 -9.6861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4051 -10.3955 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.3967 -8.9718 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.2180 -8.9670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6224 -8.2528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6308 -9.6764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4521 -9.6716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8690 -10.3810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8606 -8.9574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4437 -8.2480 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.2097 -7.5434 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.8523 -7.5337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6736 -7.5289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0780 -6.8147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0864 -8.2383 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.4354 -6.8243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8439 -6.1101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6576 -6.0228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8228 -5.2183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1085 -4.8139 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.5004 -5.3643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6956 -5.2009 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.0200 -6.1042 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
23.8993 -6.8098 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.1669 -9.6909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6820 -9.0321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6899 -10.3609 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.9072 -10.1118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9064 -9.2923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1974 -8.8851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4888 -9.2963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4936 -10.1189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2032 -10.5224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2664 -9.6701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3037 -6.0997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
1 3 1 0
3 4 1 0
4 5 1 0
4 6 1 6
6 7 1 0
7 8 1 0
7 9 1 0
5 10 1 0
5 11 2 0
10 12 1 0
12 13 1 0
13 14 1 0
13 15 2 0
12 16 1 1
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 17 1 0
21 22 2 0
17 23 1 6
14 24 1 0
1 25 1 0
25 26 2 0
26 29 1 0
28 27 1 0
27 25 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
7 34 1 0
24 35 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 470.57Molecular Weight (Monoisotopic): 470.2529AlogP: 1.93#Rotatable Bonds: 10Polar Surface Area: 129.39Molecular Species: NEUTRALHBA: 5HBD: 4#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.74CX Basic pKa: ┄CX LogP: 1.42CX LogD: 1.42Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.42Np Likeness Score: -0.10
References 1. Hoffman RL,Kania RS,Brothers MA,Davies JF,Ferre RA,Gajiwala KS,He M,Hogan RJ,Kozminski K,Li LY,Lockner JW,Lou J,Marra MT,Mitchell LJ,Murray BW,Nieman JA,Noell S,Planken SP,Rowe T,Ryan K,Smith GJ,Solowiej JE,Steppan CM,Taggart B. (2020) Discovery of Ketone-Based Covalent Inhibitors of Coronavirus 3CL Proteases for the Potential Therapeutic Treatment of COVID-19., 63 (21): [PMID:33054210 ] [10.1021/acs.jmedchem.0c01063 ]