The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-9-(2-(3-(but-3-ynyl)-3H-diazirin-3-yl)ethoxy)-6-isopropyl-10-(methoxycarbonyl)-2-oxo-6,7-dihydro-2H-pyrido[2,1-a]isoquinoline-3-carboxylic acid ID: ALA4760093
PubChem CID: 162657998
Max Phase: Preclinical
Molecular Formula: C26H27N3O6
Molecular Weight: 477.52
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C#CCCC1(CCOc2cc3c(cc2C(=O)OC)-c2cc(=O)c(C(=O)O)cn2[C@@H](C(C)C)C3)N=N1
Standard InChI: InChI=1S/C26H27N3O6/c1-5-6-7-26(27-28-26)8-9-35-23-11-16-10-20(15(2)3)29-14-19(24(31)32)22(30)13-21(29)17(16)12-18(23)25(33)34-4/h1,11-15,20H,6-10H2,2-4H3,(H,31,32)/t20-/m1/s1
Standard InChI Key: SESLHTLSTWKYKA-HXUWFJFHSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
19.8616 -24.6822 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.2782 -25.3988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6905 -24.6796 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.1391 -24.5738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1380 -25.4011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8528 -25.8140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8509 -24.1611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5663 -24.5702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5652 -25.3986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2781 -25.8115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9967 -25.4006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2804 -24.1547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9937 -24.5738 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.7094 -24.1680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7180 -23.3413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0048 -22.9221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2828 -23.3296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4363 -22.9354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1469 -23.3544 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.4438 -22.1104 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.0120 -22.0972 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.7111 -25.8133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7109 -26.6383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4256 -25.4010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4232 -25.8130 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.4246 -24.1615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4244 -23.3365 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.7103 -24.5742 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.7091 -25.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9943 -25.8119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5655 -25.8108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8514 -25.3977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1366 -25.8097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4158 -26.2154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7099 -22.9242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
1 3 2 0
4 5 2 0
5 6 1 0
6 9 2 0
8 7 2 0
7 4 1 0
8 9 1 0
8 12 1 0
9 10 1 0
10 11 1 0
11 13 1 0
12 13 1 0
12 17 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 1 0
15 18 1 0
18 19 1 0
18 20 2 0
16 21 2 0
11 22 1 1
22 23 1 0
22 24 1 0
5 25 1 0
4 26 1 0
26 27 1 0
26 28 2 0
25 29 1 0
29 30 1 0
30 2 1 0
2 31 1 0
31 32 1 0
32 33 1 0
33 34 3 0
27 35 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 477.52Molecular Weight (Monoisotopic): 477.1900AlogP: 4.10#Rotatable Bonds: 9Polar Surface Area: 119.55Molecular Species: ACIDHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.25CX Basic pKa: ┄CX LogP: 4.15CX LogD: 0.71Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.43Np Likeness Score: 0.24
References 1. Zhang Q,Huang J,Chow HY,Wang J,Zhang Y,Fung YME,Ren Q,Li X. (2020) Development of DHQ-based chemical biology probe to profile cellular targets for HBV., 30 (23.0): [PMID:33080351 ] [10.1016/j.bmcl.2020.127615 ]