The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Ethyl 2-(4-(1-(2,4-difluorophenyl)-4-oxo-4,5-dihydro-1H-pyrazolo[3,4-d]pyrimidin-6-yl)phenoxy)-2-methylpropanoate ID: ALA4760213
PubChem CID: 162657403
Max Phase: Preclinical
Molecular Formula: C23H20F2N4O4
Molecular Weight: 454.43
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)C(C)(C)Oc1ccc(-c2nc3c(cnn3-c3ccc(F)cc3F)c(=O)[nH]2)cc1
Standard InChI: InChI=1S/C23H20F2N4O4/c1-4-32-22(31)23(2,3)33-15-8-5-13(6-9-15)19-27-20-16(21(30)28-19)12-26-29(20)18-10-7-14(24)11-17(18)25/h5-12H,4H2,1-3H3,(H,27,28,30)
Standard InChI Key: ZDPNWLQVMBFQTE-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
3.6991 -30.2856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1138 -30.9988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5242 -30.2831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5473 -30.1736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5461 -31.0011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2617 -31.4121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9789 -31.0007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9761 -30.1700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2599 -29.7586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6825 -29.7539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3997 -30.1675 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.3884 -28.5171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6781 -28.9320 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.1102 -28.9248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1132 -29.7488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8980 -29.9993 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.3817 -29.3343 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.8932 -28.6687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1517 -30.7806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6027 -31.3968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8586 -32.1803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6674 -32.3488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2196 -31.7318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9566 -30.9506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3825 -27.6918 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8305 -31.4112 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4000 -31.4101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6851 -30.9989 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.9737 -31.4089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3994 -32.2353 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.5064 -30.3328 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
10.9249 -33.1327 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.2629 -30.9978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
10 11 2 0
11 15 1 0
14 12 1 0
12 13 1 0
13 10 1 0
8 10 1 0
14 15 2 0
15 16 1 0
16 17 1 0
17 18 2 0
18 14 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
16 19 1 0
12 25 2 0
5 26 1 0
26 2 1 0
2 27 1 0
27 28 1 0
28 29 1 0
27 30 2 0
24 31 1 0
22 32 1 0
29 33 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 454.43Molecular Weight (Monoisotopic): 454.1453AlogP: 3.77#Rotatable Bonds: 6Polar Surface Area: 99.10Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.24CX Basic pKa: ┄CX LogP: 3.91CX LogD: 3.91Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.45Np Likeness Score: -1.57
References 1. Gupta S,Rai AK,Pandey S,Singh LR,Kant R,Tamrakar AK,Sashidhara KV. (2021) Microwave-assisted efficient synthesis of pyrazole-fibrate derivatives as stimulators of glucose uptake in skeletal muscle cells., 34 [PMID:33359606 ] [10.1016/j.bmcl.2020.127760 ]