(S,Z)-N-(1-bromo-3-((1-hydroxy-3-phenylpropan-2-yl)amino)-3-oxo-1-phenylprop-1-en-2-yl)-4-fluoro-2-methylbenzamide

ID: ALA4760443

PubChem CID: 162657810

Max Phase: Preclinical

Molecular Formula: C26H24BrFN2O3

Molecular Weight: 511.39

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cc(F)ccc1C(=O)N/C(C(=O)N[C@H](CO)Cc1ccccc1)=C(\Br)c1ccccc1

Standard InChI:  InChI=1S/C26H24BrFN2O3/c1-17-14-20(28)12-13-22(17)25(32)30-24(23(27)19-10-6-3-7-11-19)26(33)29-21(16-31)15-18-8-4-2-5-9-18/h2-14,21,31H,15-16H2,1H3,(H,29,33)(H,30,32)/b24-23-/t21-/m0/s1

Standard InChI Key:  ADPUGOZXWSDPOW-HGJUWQSKSA-N

Molfile:  

 
     RDKit          2D

 33 35  0  0  0  0  0  0  0  0999 V2000
    7.4978   -8.9437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4966   -9.7632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2047  -10.1722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9143   -9.7627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9115   -8.9401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2029   -8.5348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2045  -10.9894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4966  -11.3978    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
    8.9121  -11.3981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9119  -12.2153    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.6199  -10.9897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3275  -11.3985    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.6201  -10.1725    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.0353  -10.9901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7429  -11.3988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0355  -10.1729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7433   -9.7644    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.7427  -12.2160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6195  -12.6241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6193  -13.4413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3273  -12.2157    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.9124  -13.8475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9119  -14.6639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6200  -15.0735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3302  -14.6607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3272  -13.8456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0353  -12.6202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0347  -13.4366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7429  -13.8462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4530  -13.4334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4501  -12.6183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2053  -13.4379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6209  -15.8907    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  3  7  1  0
  7  8  1  0
  7  9  2  0
  9 10  1  0
  9 11  1  0
 11 12  1  0
 11 13  2  0
 14 12  1  6
 14 15  1  0
 14 16  1  0
 16 17  1  0
 15 18  1  0
 10 19  1  0
 19 20  1  0
 19 21  2  0
 20 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 20  1  0
 18 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 18  1  0
 22 32  1  0
 24 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4760443

    ---

Associated Targets(Human)

HepG2 2.2.15 (869 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Hepatitis B virus (7925 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 511.39Molecular Weight (Monoisotopic): 510.0954AlogP: 4.35#Rotatable Bonds: 8
Polar Surface Area: 78.43Molecular Species: NEUTRALHBA: 3HBD: 3
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.19CX Basic pKa: CX LogP: 4.43CX LogD: 4.43
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.39Np Likeness Score: -0.74

References

1. Gu X,Zhang Y,Zou Y,Li X,Guan M,Zhou Q,Qiu J.  (2021)  Synthesis and evaluation of new phenyl acrylamide derivatives as potent non-nucleoside anti-HBV agents.,  29  [PMID:33285406] [10.1016/j.bmc.2020.115892]

Source