6-(2-Fluoro-6-methoxyphenyl)-1-(6-(4-methylpiperazin-1-yl)pyridin-2-yl)-1H-pyrazolo[4,3-c]pyridine

ID: ALA4760447

PubChem CID: 155817683

Max Phase: Preclinical

Molecular Formula: C23H23FN6O

Molecular Weight: 418.48

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cccc(F)c1-c1cc2c(cn1)cnn2-c1cccc(N2CCN(C)CC2)n1

Standard InChI:  InChI=1S/C23H23FN6O/c1-28-9-11-29(12-10-28)21-7-4-8-22(27-21)30-19-13-18(25-14-16(19)15-26-30)23-17(24)5-3-6-20(23)31-2/h3-8,13-15H,9-12H2,1-2H3

Standard InChI Key:  KAOYHQWWTGUIBS-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 35  0  0  0  0  0  0  0  0999 V2000
   13.4492   -7.6188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4481   -8.4384    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.1561   -8.8473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1543   -7.2100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8630   -7.6152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8677   -8.4338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6478   -8.6823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1251   -8.0172    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.6400   -7.3578    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.8880   -6.5791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7414   -7.2104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7446   -6.3923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0377   -5.9839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3291   -6.3927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4532   -5.9851    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.0394   -7.6188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3284   -7.2171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4549   -5.1679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0446   -8.4360    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   16.6881   -6.4093    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.9362   -5.6314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3856   -5.0264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5837   -5.2045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3393   -5.9821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7346   -5.4572    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.2829   -6.0691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0782   -5.8975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3307   -5.1199    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.7814   -4.5136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9797   -4.6848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1297   -4.9488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  1  0
  9 10  1  0
  1 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 17  1  0
 16 11  1  0
 12 15  1  0
 16 17  2  0
 15 18  1  0
 16 19  1  0
 10 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 10  1  0
 21 25  1  0
 25 26  1  0
 25 30  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 28 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4760447

    ---

Associated Targets(Human)

MAP4K1 Tchem Mitogen-activated protein kinase kinase kinase kinase 1 (947 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 418.48Molecular Weight (Monoisotopic): 418.1917AlogP: 3.38#Rotatable Bonds: 4
Polar Surface Area: 59.31Molecular Species: NEUTRALHBA: 7HBD:
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 7.73CX LogP: 3.80CX LogD: 3.31
Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.51Np Likeness Score: -1.46

References

1. Yu EC,Methot JL,Fradera X,Lesburg CA,Lacey BM,Siliphaivanh P,Liu P,Smith DM,Xu Z,Piesvaux JA,Kawamura S,Xu H,Miller JR,Bittinger M,Pasternak A.  (2021)  Identification of Potent Reverse Indazole Inhibitors for HPK1.,  12  (3.0): [PMID:33738073] [10.1021/acsmedchemlett.0c00672]

Source