The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-2-(4-bromobenzoyl)-N-(tert-butyl)-4-(4-fluorobenzylidene)-1-isopropyl-5-oxopyrrolidine-2-carboxamide ID: ALA4760591
PubChem CID: 162658210
Max Phase: Preclinical
Molecular Formula: C26H28BrFN2O3
Molecular Weight: 515.42
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)N1C(=O)/C(=C/c2ccc(F)cc2)CC1(C(=O)NC(C)(C)C)C(=O)c1ccc(Br)cc1
Standard InChI: InChI=1S/C26H28BrFN2O3/c1-16(2)30-23(32)19(14-17-6-12-21(28)13-7-17)15-26(30,24(33)29-25(3,4)5)22(31)18-8-10-20(27)11-9-18/h6-14,16H,15H2,1-5H3,(H,29,33)/b19-14+
Standard InChI Key: LUDJRTLVEZNUGG-XMHGGMMESA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
26.5676 -5.7839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2398 -7.5159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0637 -7.5170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4747 -6.8052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0631 -6.0919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2361 -6.0948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8288 -6.8070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4748 -5.3762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3005 -5.3748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7862 -6.0417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5697 -4.9595 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.7840 -4.7057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5270 -3.9210 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.8272 -8.2311 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
27.3932 -5.7839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5634 -6.6096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8463 -7.0189 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.2763 -7.0260 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.8421 -7.8445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1249 -8.2537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5551 -8.2609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8378 -8.6695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8061 -5.0688 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.1063 -6.1968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1025 -7.0218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8148 -7.4345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5298 -7.0234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5282 -6.1952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8154 -5.7860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2450 -7.4361 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
26.9762 -4.2410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8019 -4.2338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5572 -3.5296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 2 1 0
5 8 1 0
8 9 2 0
9 10 1 0
10 1 1 0
1 11 1 0
11 12 1 0
12 9 1 0
12 13 2 0
2 14 1 0
1 15 1 0
1 16 1 0
16 17 1 0
16 18 2 0
17 19 1 0
19 20 1 0
19 21 1 0
19 22 1 0
15 23 2 0
15 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
27 30 1 0
11 31 1 0
31 32 1 0
31 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 515.42Molecular Weight (Monoisotopic): 514.1267AlogP: 5.15#Rotatable Bonds: 5Polar Surface Area: 66.48Molecular Species: NEUTRALHBA: 3HBD: 1#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.16CX LogD: 5.16Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.34Np Likeness Score: -0.59
References 1. Zhu XL,Tian XQ,Xu HH,Wang HM,Chen QH,Zeng XH. (2020) Rhopaladins' analogue (E)-2-aroyl-4-(4-fluorobenzylidene)-5-oxopyrrolidines inhibit proliferation, promote apoptosis and down-regulation of E6/E7 mRNA in cervical cancer., 30 (23): [PMID:32950616 ] [10.1016/j.bmcl.2020.127554 ]