(E)-2-(4-bromobenzoyl)-N-(tert-butyl)-4-(4-fluorobenzylidene)-1-isopropyl-5-oxopyrrolidine-2-carboxamide

ID: ALA4760591

PubChem CID: 162658210

Max Phase: Preclinical

Molecular Formula: C26H28BrFN2O3

Molecular Weight: 515.42

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)N1C(=O)/C(=C/c2ccc(F)cc2)CC1(C(=O)NC(C)(C)C)C(=O)c1ccc(Br)cc1

Standard InChI:  InChI=1S/C26H28BrFN2O3/c1-16(2)30-23(32)19(14-17-6-12-21(28)13-7-17)15-26(30,24(33)29-25(3,4)5)22(31)18-8-10-20(27)11-9-18/h6-14,16H,15H2,1-5H3,(H,29,33)/b19-14+

Standard InChI Key:  LUDJRTLVEZNUGG-XMHGGMMESA-N

Molfile:  

 
     RDKit          2D

 33 35  0  0  0  0  0  0  0  0999 V2000
   26.5676   -5.7839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2398   -7.5159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0637   -7.5170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4747   -6.8052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0631   -6.0919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2361   -6.0948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8288   -6.8070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4748   -5.3762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3005   -5.3748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7862   -6.0417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5697   -4.9595    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.7840   -4.7057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5270   -3.9210    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.8272   -8.2311    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   27.3932   -5.7839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5634   -6.6096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8463   -7.0189    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.2763   -7.0260    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.8421   -7.8445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1249   -8.2537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5551   -8.2609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8378   -8.6695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8061   -5.0688    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.1063   -6.1968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1025   -7.0218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8148   -7.4345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5298   -7.0234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5282   -6.1952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8154   -5.7860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2450   -7.4361    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   26.9762   -4.2410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8019   -4.2338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5572   -3.5296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  2  1  0
  5  8  1  0
  8  9  2  0
  9 10  1  0
 10  1  1  0
  1 11  1  0
 11 12  1  0
 12  9  1  0
 12 13  2  0
  2 14  1  0
  1 15  1  0
  1 16  1  0
 16 17  1  0
 16 18  2  0
 17 19  1  0
 19 20  1  0
 19 21  1  0
 19 22  1  0
 15 23  2  0
 15 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 27 30  1  0
 11 31  1  0
 31 32  1  0
 31 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4760591

    ---

Associated Targets(Human)

Ca-Ski (420 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 515.42Molecular Weight (Monoisotopic): 514.1267AlogP: 5.15#Rotatable Bonds: 5
Polar Surface Area: 66.48Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: CX LogP: 5.16CX LogD: 5.16
Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.34Np Likeness Score: -0.59

References

1. Zhu XL,Tian XQ,Xu HH,Wang HM,Chen QH,Zeng XH.  (2020)  Rhopaladins' analogue (E)-2-aroyl-4-(4-fluorobenzylidene)-5-oxopyrrolidines inhibit proliferation, promote apoptosis and down-regulation of E6/E7 mRNA in cervical cancer.,  30  (23): [PMID:32950616] [10.1016/j.bmcl.2020.127554]

Source